EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:194138 - methyl trans-cinnamate
| Formula | C10H10O2 |
| Net Charge | 0 |
| Average Mass | 162.188 |
| Monoisotopic Mass | 162.06808 |
| SMILES | COC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C10H10O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-8H,1H3/b8-7+ |
| InChIKey | CCRCUPLGCSFEDV-BQYQJAHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia katsumadae (ncbitaxon:1934112) | - | PubMed (32456334) | |
| Conocephalum salebrosum (ncbitaxon:357981) | - | PubMed (31078779) | |
| Mespilodaphne quixos (ncbitaxon:121078) | - | PubMed (34685981) | Species also known as Ocotea quixos. |
| Tricholoma matsutake (ncbitaxon:40145) | - | DOI (10.1007/s00217-020-03606-9) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. flavouring agent A food additive that is used to added improve the taste or odour of a food. insect attractant A chemical that attracts insects. |
| Applications: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). anti-inflammatory agent Any compound that has anti-inflammatory effects. flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl trans-cinnamate (CHEBI:194138) has functional parent trans-cinnamic acid (CHEBI:35697) |
| methyl trans-cinnamate (CHEBI:194138) has role antibacterial agent (CHEBI:33282) |
| methyl trans-cinnamate (CHEBI:194138) has role fungal metabolite (CHEBI:76946) |
| methyl trans-cinnamate (CHEBI:194138) has role nematicide (CHEBI:25491) |
| methyl trans-cinnamate (CHEBI:194138) has role plant metabolite (CHEBI:76924) |
| methyl trans-cinnamate (CHEBI:194138) is a methyl cinnamate (CHEBI:6857) |
| IUPAC Name |
|---|
| methyl (2E)-3-phenylprop-2-enoate |
| Synonyms | Source |
|---|---|
| (E)-3-phenylacrylic acid methyl ester | NIST Chemistry WebBook |
| (E)-cinnamic acid methyl ester | NIST Chemistry WebBook |
| (E)-methyl cinnamate | NIST Chemistry WebBook |
| trans-cinnamic acid methyl ester | ChemIDplus |
| trans-methyl 3-phenyl-2-propenoate | NIST Chemistry WebBook |
| trans-methyl cinnamate | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (E)-cinnamic acid methyl ester | UniProt |
| Citations |
|---|