EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O4 |
| Net Charge | 0 |
| Average Mass | 180.159 |
| Monoisotopic Mass | 180.04226 |
| SMILES | O=C(O)/C=C/c1cccc(O)c1O |
| InChI | InChI=1S/C9H8O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-5,10,13H,(H,11,12)/b5-4+ |
| InChIKey | SIUKXCMDYPYCLH-SNAWJCMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydroxy-trans-cinnamic acid (CHEBI:32356) has functional parent trans-cinnamic acid (CHEBI:35697) |
| 2,3-dihydroxy-trans-cinnamic acid (CHEBI:32356) has role Escherichia coli metabolite (CHEBI:76971) |
| 2,3-dihydroxy-trans-cinnamic acid (CHEBI:32356) is a 2,3-dihydroxycinnamic acid (CHEBI:48681) |
| 2,3-dihydroxy-trans-cinnamic acid (CHEBI:32356) is conjugate acid of 2,3-dihydroxy-trans-cinnamate (CHEBI:58642) |
| Incoming Relation(s) |
| 2,3-dihydroxy-trans-cinnamate (CHEBI:58642) is conjugate base of 2,3-dihydroxy-trans-cinnamic acid (CHEBI:32356) |
| IUPAC Name |
|---|
| (2E)-3-(2,3-dihydroxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| (2E)-3-(2,3-dihydroxyphenyl)acrylic acid | IUPAC |
| trans-2,3-Dihydroxycinnamate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12623 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2097344 | Beilstein |