EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C68H108O25 |
| Net Charge | 0 |
| Average Mass | 1325.587 |
| Monoisotopic Mass | 1324.71797 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O[C@]3([H])O[C@@H](C)[C@H](OC(=O)[C@@H](C)CC)[C@@H](OC(=O)/C=C/c4ccccc4)[C@H]3O)[C@H](C)O[C@@H](O[C@@]3([H])[C@H](C)O[C@H]4O[C@@]5([H])[C@H](O[C@@H](CCCCC)CCCCCCCCCC(=O)O[C@H]3[C@H]4O)O[C@H](C)[C@H](O)[C@@H]5O)[C@@H]2OC(=O)CCCCCCC)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C68H108O25/c1-10-13-15-19-27-34-46(70)88-62-61(93-64-52(76)50(74)48(72)38(5)80-64)57(90-65-53(77)58(55(40(7)82-65)89-63(79)37(4)12-3)87-47(71)36-35-43-29-24-22-25-30-43)42(9)84-68(62)91-56-41(8)83-66-54(78)59(56)86-45(69)33-28-21-18-16-17-20-26-32-44(31-23-14-11-2)85-67-60(92-66)51(75)49(73)39(6)81-67/h22,24-25,29-30,35-42,44,48-62,64-68,72-78H,10-21,23,26-28,31-34H2,1-9H3/b36-35+/t37-,38-,39+,40-,41-,42-,44-,48-,49-,50+,51-,52+,53+,54+,55-,56-,57-,58-,59-,60+,61+,62+,64-,65-,66-,67-,68-/m0/s1 |
| InChIKey | WMRCZJJWLYGRFG-ZQHADSKGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ipomoea pes-caprae (ncbitaxon:89656) | aerial part (BTO:0001658) | PubMed (21338052) | The air-dried aerial parts were powdered and refluxed with 95% EtOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pescaprein XXVIII (CHEBI:67858) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| pescaprein XXVIII (CHEBI:67858) has functional parent trans-cinnamic acid (CHEBI:35697) |
| pescaprein XXVIII (CHEBI:67858) has functional parent jalapinolic acid (CHEBI:75785) |
| pescaprein XXVIII (CHEBI:67858) has role metabolite (CHEBI:25212) |
| pescaprein XXVIII (CHEBI:67858) is a cinnamate ester (CHEBI:36087) |
| pescaprein XXVIII (CHEBI:67858) is a macrocyclic lactone (CHEBI:63944) |
| pescaprein XXVIII (CHEBI:67858) is a octanoate ester (CHEBI:87657) |
| pescaprein XXVIII (CHEBI:67858) is a pentasaccharide derivative (CHEBI:63566) |
| pescaprein XXVIII (CHEBI:67858) is a resin glycoside (CHEBI:75756) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21523280 | Reaxys |
| Citations |
|---|