EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N2O |
| Net Charge | 0 |
| Average Mass | 258.365 |
| Monoisotopic Mass | 258.17321 |
| SMILES | C[C@@H]1CN(C(=O)/C=C/c2ccccc2)[C@H](C)CN1C |
| InChI | InChI=1S/C16H22N2O/c1-13-12-18(14(2)11-17(13)3)16(19)10-9-15-7-5-4-6-8-15/h4-10,13-14H,11-12H2,1-3H3/b10-9+/t13-,14-/m1/s1 |
| InChIKey | MIGGJPIAMPJCES-NPUYYSGSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | DOI (10.1080/00021369.1985.10867263) | Strain: I-639 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigerazine A (CHEBI:133755) has functional parent trans-cinnamic acid (CHEBI:35697) |
| nigerazine A (CHEBI:133755) has role Aspergillus metabolite (CHEBI:76956) |
| nigerazine A (CHEBI:133755) is a N-acylpiperazine (CHEBI:46844) |
| nigerazine A (CHEBI:133755) is a N-alkylpiperazine (CHEBI:46845) |
| nigerazine A (CHEBI:133755) is a alkaloid (CHEBI:22315) |
| nigerazine A (CHEBI:133755) is a enamide (CHEBI:51751) |
| nigerazine A (CHEBI:133755) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (2E)-3-phenyl-1-[(2R,5R)-2,4,5-trimethylpiperazin-1-yl]prop-2-en-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6893074 | Reaxys |
| Citations |
|---|