EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H42O17 |
| Net Charge | 0 |
| Average Mass | 770.737 |
| Monoisotopic Mass | 770.24220 |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@]2(COC(C)=O)O[C@H](COC(=O)/C=C/c3ccccc3)[C@@H](O)[C@@H]2OC(=O)/C=C/c2ccccc2)[C@H](OC(C)=O)[C@@H](O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C38H42O17/c1-22(39)47-20-29-34(50-24(3)41)33(46)35(51-25(4)42)37(52-29)55-38(21-49-23(2)40)36(53-31(44)18-16-27-13-9-6-10-14-27)32(45)28(54-38)19-48-30(43)17-15-26-11-7-5-8-12-26/h5-18,28-29,32-37,45-46H,19-21H2,1-4H3/b17-15+,18-16+/t28-,29-,32-,33+,34-,35-,36+,37+,38+/m1/s1 |
| InChIKey | KUZYDHCVYKUFKF-LPLPFJSBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllanthus niruri (ncbitaxon:296034) | leaf (BTO:0000713) | PubMed (8991954) | Dried leaves |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| niruriside (CHEBI:66627) has functional parent trans-cinnamic acid (CHEBI:35697) |
| niruriside (CHEBI:66627) has role anti-HIV agent (CHEBI:64946) |
| niruriside (CHEBI:66627) has role metabolite (CHEBI:25212) |
| niruriside (CHEBI:66627) is a O-acyl carbohydrate (CHEBI:52782) |
| niruriside (CHEBI:66627) is a acetate ester (CHEBI:47622) |
| niruriside (CHEBI:66627) is a cinnamate ester (CHEBI:36087) |
| niruriside (CHEBI:66627) is a disaccharide derivative (CHEBI:63353) |
| IUPAC Name |
|---|
| 1-O-acetyl-3,6-bis-O-[(2E)-3-phenylprop-2-enoyl]-β-D-fructofuranosyl 2,4,6-tri-O-acetyl-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| alpha-D-Glucopyranoside, 1-O-acetyl-3,6-bis-O-(1-oxo-3-phenyl-2-propenyl)-beta-D-fructofuranosyl, 2,4,6-triacetate, (E,E)- | ChemIDplus |
| β-D-(1-O-acetyl-3,6-O-trans-dicinnamoyl)fructofuranosyl α-D-(2,4,6-O-triacetyl)glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:173268-90-1 | ChemIDplus |
| Citations |
|---|