EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H42O17 |
| Net Charge | 0 |
| Average Mass | 770.737 |
| Monoisotopic Mass | 770.24220 |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@]2(COC(C)=O)O[C@H](COC(=O)/C=C/c3ccccc3)[C@@H](O)[C@@H]2OC(=O)/C=C/c2ccccc2)[C@H](OC(C)=O)[C@@H](O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C38H42O17/c1-22(39)47-20-29-34(50-24(3)41)33(46)35(51-25(4)42)37(52-29)55-38(21-49-23(2)40)36(53-31(44)18-16-27-13-9-6-10-14-27)32(45)28(54-38)19-48-30(43)17-15-26-11-7-5-8-12-26/h5-18,28-29,32-37,45-46H,19-21H2,1-4H3/b17-15+,18-16+/t28-,29-,32-,33+,34-,35-,36+,37+,38+/m1/s1 |
| InChIKey | KUZYDHCVYKUFKF-LPLPFJSBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllanthus niruri (ncbitaxon:296034) | leaf (BTO:0000713) | PubMed (8991954) | Dried leaves |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| niruriside (CHEBI:66627) has functional parent trans-cinnamic acid (CHEBI:35697) |
| niruriside (CHEBI:66627) has role anti-HIV agent (CHEBI:64946) |
| niruriside (CHEBI:66627) has role metabolite (CHEBI:25212) |
| niruriside (CHEBI:66627) is a O-acyl carbohydrate (CHEBI:52782) |
| niruriside (CHEBI:66627) is a acetate ester (CHEBI:47622) |
| niruriside (CHEBI:66627) is a cinnamate ester (CHEBI:36087) |
| niruriside (CHEBI:66627) is a disaccharide derivative (CHEBI:63353) |
| IUPAC Name |
|---|
| 1-O-acetyl-3,6-bis-O-[(2E)-3-phenylprop-2-enoyl]-β-D-fructofuranosyl 2,4,6-tri-O-acetyl-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| alpha-D-Glucopyranoside, 1-O-acetyl-3,6-bis-O-(1-oxo-3-phenyl-2-propenyl)-beta-D-fructofuranosyl, 2,4,6-triacetate, (E,E)- | ChemIDplus |
| β-D-(1-O-acetyl-3,6-O-trans-dicinnamoyl)fructofuranosyl α-D-(2,4,6-O-triacetyl)glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:173268-90-1 | ChemIDplus |
| Citations |
|---|