EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C69H110O25 |
| Net Charge | 0 |
| Average Mass | 1339.614 |
| Monoisotopic Mass | 1338.73362 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O[C@]3([H])O[C@@H](C)[C@H](OC(=O)C(C)C)[C@@H](OC(=O)/C=C/c4ccccc4)[C@H]3O)[C@H](C)O[C@@H](O[C@@]3([H])[C@H](C)O[C@H]4O[C@@]5([H])[C@H](O[C@@H](CCCCC)CCCCCCCCCC(=O)O[C@H]3[C@H]4O)O[C@H](C)[C@H](O)[C@@H]5O)[C@@H]2OC(=O)CCCCCCCCC)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C69H110O25/c1-10-12-14-15-17-21-29-35-47(71)89-63-62(94-65-53(77)51(75)49(73)39(5)81-65)58(91-66-54(78)59(56(41(7)83-66)90-64(80)38(3)4)88-48(72)37-36-44-30-25-23-26-31-44)43(9)85-69(63)92-57-42(8)84-67-55(79)60(57)87-46(70)34-28-22-19-16-18-20-27-33-45(32-24-13-11-2)86-68-61(93-67)52(76)50(74)40(6)82-68/h23,25-26,30-31,36-43,45,49-63,65-69,73-79H,10-22,24,27-29,32-35H2,1-9H3/b37-36+/t39-,40+,41-,42-,43-,45-,49-,50-,51+,52-,53+,54+,55+,56-,57-,58-,59-,60-,61+,62+,63+,65-,66-,67-,68-,69-/m0/s1 |
| InChIKey | ZBJCKZGRNIECHV-XCUAYSHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ipomoea pes-caprae (ncbitaxon:89656) | aerial part (BTO:0001658) | PubMed (21338052) | The air-dried aerial parts were powdered and refluxed with 95% EtOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pescaprein XXVI (CHEBI:67856) has functional parent trans-cinnamic acid (CHEBI:35697) |
| pescaprein XXVI (CHEBI:67856) has functional parent decanoic acid (CHEBI:30813) |
| pescaprein XXVI (CHEBI:67856) has functional parent isobutyric acid (CHEBI:16135) |
| pescaprein XXVI (CHEBI:67856) has functional parent jalapinolic acid (CHEBI:75785) |
| pescaprein XXVI (CHEBI:67856) has role metabolite (CHEBI:25212) |
| pescaprein XXVI (CHEBI:67856) is a cinnamate ester (CHEBI:36087) |
| pescaprein XXVI (CHEBI:67856) is a decanoate ester (CHEBI:87658) |
| pescaprein XXVI (CHEBI:67856) is a macrocyclic lactone (CHEBI:63944) |
| pescaprein XXVI (CHEBI:67856) is a pentasaccharide derivative (CHEBI:63566) |
| pescaprein XXVI (CHEBI:67856) is a resin glycoside (CHEBI:75756) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21523281 | Reaxys |
| Citations |
|---|