EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7F3O2 |
| Net Charge | 0 |
| Average Mass | 216.158 |
| Monoisotopic Mass | 216.03981 |
| SMILES | O=C(O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H7F3O2/c11-10(12,13)8-4-1-7(2-5-8)3-6-9(14)15/h1-6H,(H,14,15)/b6-3+ |
| InChIKey | ANRMAUMHJREENI-ZZXKWVIFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-4-(trifluoromethyl)cinnamic acid (CHEBI:60705) has functional parent trans-cinnamic acid (CHEBI:35697) |
| (E)-4-(trifluoromethyl)cinnamic acid (CHEBI:60705) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| (E)-4-(trifluoromethyl)cinnamic acid (CHEBI:60705) is a cinnamic acids (CHEBI:23252) |
| Incoming Relation(s) |
| (E)-4-(trifluoromethyl)cinnamoyl group (CHEBI:60674) is substituent group from (E)-4-(trifluoromethyl)cinnamic acid (CHEBI:60705) |
| IUPAC Name |
|---|
| (2E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| (2E)-3-(4-trifluoromethylphenyl)acrylic acid | ChEBI |
| para-(trifluoromethyl)cinnamic acid | ChEBI |
| p-(trifluoromethyl)cinnamic acid | ChEBI |
| trans-4-trifluoromethylcinnamic acid | ChEBI |
| (E)-3-[4'-(trifluoromethyl)phenyl]-2-propenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2452800 | Reaxys |