EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:25219 - methacrylic acid
| Formula | C4H6O2 |
| Net Charge | 0 |
| Average Mass | 86.090 |
| Monoisotopic Mass | 86.03678 |
| SMILES | C=C(C)C(=O)O |
| InChI | InChI=1S/C4H6O2/c1-3(2)4(5)6/h1H2,2H3,(H,5,6) |
| InChIKey | CERQOIWHTDAKMF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methacrylic acid (CHEBI:25219) has functional parent acrylic acid (CHEBI:18308) |
| methacrylic acid (CHEBI:25219) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| methacrylic acid (CHEBI:25219) is conjugate acid of methacrylate (CHEBI:25218) |
| Incoming Relation(s) |
| (Z)-2-methylureidoacrylic acid (CHEBI:143867) has functional parent methacrylic acid (CHEBI:25219) |
| (Z)-2-methylureidoperacrylic acid (CHEBI:63249) has functional parent methacrylic acid (CHEBI:25219) |
| (Z)-3-amino-2-methylacrylic acid (CHEBI:145742) has functional parent methacrylic acid (CHEBI:25219) |
| 2-hydroxyethyl methacrylate (CHEBI:34288) has functional parent methacrylic acid (CHEBI:25219) |
| 2-hydroxypropyl methacrylate (CHEBI:53440) has functional parent methacrylic acid (CHEBI:25219) |
| bisphenol A dimethacrylate (CHEBI:34579) has functional parent methacrylic acid (CHEBI:25219) |
| ethylene glycol dimethacrylate (CHEBI:53436) has functional parent methacrylic acid (CHEBI:25219) |
| glycidyl methacrylate (CHEBI:132844) has functional parent methacrylic acid (CHEBI:25219) |
| methacrylyl-CoA (CHEBI:27754) has functional parent methacrylic acid (CHEBI:25219) |
| methyl methacrylate (CHEBI:34840) has functional parent methacrylic acid (CHEBI:25219) |
| poly(ethylene glycol monomethacrylate) (CHEBI:53709) has functional parent methacrylic acid (CHEBI:25219) |
| trichagmalin B (CHEBI:68360) has functional parent methacrylic acid (CHEBI:25219) |
| methacrylate (CHEBI:25218) is conjugate base of methacrylic acid (CHEBI:25219) |
| IUPAC Name |
|---|
| 2-methylprop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 2-methyl-2-propenoic acid | NIST Chemistry WebBook |
| 2-methylacrylic acid | ChemIDplus |
| 2-methylenepropionic acid | ChemIDplus |
| 2-methylpropenoic acid | NIST Chemistry WebBook |
| 2-Methylpropensäure | ChEBI |
| methacrylic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Methacrylic_acid | Wikipedia |
| Citations |
|---|