EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40N7O17P3S |
| Net Charge | 0 |
| Average Mass | 835.616 |
| Monoisotopic Mass | 835.14142 |
| SMILES | C=C(C)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C25H40N7O17P3S/c1-13(2)24(37)53-8-7-27-15(33)5-6-28-22(36)19(35)25(3,4)10-46-52(43,44)49-51(41,42)45-9-14-18(48-50(38,39)40)17(34)23(47-14)32-12-31-16-20(26)29-11-30-21(16)32/h11-12,14,17-19,23,34-35H,1,5-10H2,2-4H3,(H,27,33)(H,28,36)(H,41,42)(H,43,44)(H2,26,29,30)(H2,38,39,40)/t14-,17-,18-,19+,23-/m1/s1 |
| InChIKey | NPALUEYCDZWBOV-NDZSKPAWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methacrylyl-CoA (CHEBI:27754) has functional parent coenzyme A (CHEBI:15346) |
| methacrylyl-CoA (CHEBI:27754) has functional parent methacrylic acid (CHEBI:25219) |
| methacrylyl-CoA (CHEBI:27754) has role human metabolite (CHEBI:77746) |
| methacrylyl-CoA (CHEBI:27754) has role mouse metabolite (CHEBI:75771) |
| methacrylyl-CoA (CHEBI:27754) is a acyl-CoA (CHEBI:17984) |
| methacrylyl-CoA (CHEBI:27754) is conjugate acid of methacrylyl-CoA(4−) (CHEBI:62500) |
| Incoming Relation(s) |
| methacrylyl-CoA(4−) (CHEBI:62500) is conjugate base of methacrylyl-CoA (CHEBI:27754) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-{[3-({2-[(2-methylprop-2-enoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 2-Methylprop-2-enoyl-CoA | KEGG COMPOUND |
| Methacrylyl-CoA | KEGG COMPOUND |
| Methylacrylyl-CoA | KEGG COMPOUND |
| Methacrylyl-coenzyme A | ChemIDplus |
| S-methacryloyl-coenzyme-A | ChEBI |
| S-methacryloyl-CoA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C03460 | KEGG COMPOUND |
| METHACRYLYL-COA | MetaCyc |
| DB01675 | DrugBank |
| 2MC | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:78213 | Reaxys |
| CAS:6008-91-9 | ChemIDplus |
| Citations |
|---|