EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5O2 |
| Net Charge | -1 |
| Average Mass | 85.082 |
| Monoisotopic Mass | 85.02950 |
| SMILES | C=C(C)C(=O)[O-] |
| InChI | InChI=1S/C4H6O2/c1-3(2)4(5)6/h1H2,2H3,(H,5,6)/p-1 |
| InChIKey | CERQOIWHTDAKMF-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methacrylate (CHEBI:25218) has functional parent acrylate (CHEBI:37080) |
| methacrylate (CHEBI:25218) is a monocarboxylic acid anion (CHEBI:35757) |
| methacrylate (CHEBI:25218) is conjugate base of methacrylic acid (CHEBI:25219) |
| Incoming Relation(s) |
| methacrylic acid (CHEBI:25219) is conjugate acid of methacrylate (CHEBI:25218) |
| IUPAC Name |
|---|
| 2-methylprop-2-enoate |
| Synonyms | Source |
|---|---|
| 2-methyl-2-propenoic acid, ion(1−) | ChemIDplus |
| 2-methyl-2-propenoate | ChemIDplus |
| methacrylate | UM-BBD |
| methacrylate(1−) | ChEBI |
| methacrylate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methylprop-2-enoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| c0520 | UM-BBD |
| Registry Numbers | Sources |
|---|---|
| Gmelin:324367 | Gmelin |
| Reaxys:3587577 | Reaxys |
| CAS:18358-13-9 | ChemIDplus |