EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O4 |
| Net Charge | 0 |
| Average Mass | 364.441 |
| Monoisotopic Mass | 364.16746 |
| SMILES | C=C(C)C(=O)Oc1ccc(C(C)(C)c2ccc(OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C23H24O4/c1-15(2)21(24)26-19-11-7-17(8-12-19)23(5,6)18-9-13-20(14-10-18)27-22(25)16(3)4/h7-14H,1,3H2,2,4-6H3 |
| InChIKey | QUZSUMLPWDHKCJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisphenol A dimethacrylate (CHEBI:34579) has functional parent bisphenol A (CHEBI:33216) |
| bisphenol A dimethacrylate (CHEBI:34579) has functional parent methacrylic acid (CHEBI:25219) |
| bisphenol A dimethacrylate (CHEBI:34579) has role metabolite (CHEBI:25212) |
| bisphenol A dimethacrylate (CHEBI:34579) is a bisphenol (CHEBI:22901) |
| bisphenol A dimethacrylate (CHEBI:34579) is a enoate ester (CHEBI:51702) |
| Synonyms | Source |
|---|---|
| 2,2-Di(4-methacryloxyphenyl)propane | KEGG COMPOUND |
| 4,4'-Isopropylidenediphenol dimethacrylate | ChemIDplus |