EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O3 |
| Net Charge | 0 |
| Average Mass | 144.170 |
| Monoisotopic Mass | 144.07864 |
| SMILES | C=C(C)C(=O)OCC(C)O |
| InChI | InChI=1S/C7H12O3/c1-5(2)7(9)10-4-6(3)8/h6,8H,1,4H2,2-3H3 |
| InChIKey | VHSHLMUCYSAUQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | polymerisation monomer Any compound used as a monomer for a polymerisation process. The term is generally used in relation to industrial polymerisation processes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxypropyl methacrylate (CHEBI:53440) has functional parent methacrylic acid (CHEBI:25219) |
| 2-hydroxypropyl methacrylate (CHEBI:53440) has functional parent propane-1,2-diol (CHEBI:16997) |
| 2-hydroxypropyl methacrylate (CHEBI:53440) has role polymerisation monomer (CHEBI:74236) |
| 2-hydroxypropyl methacrylate (CHEBI:53440) is a enoate ester (CHEBI:51702) |
| IUPAC Name |
|---|
| 2-hydroxypropyl methacrylate |
| Synonyms | Source |
|---|---|
| HPMA | ChEBI |
| 2-Hydroxypropyl methacrylate | ChemIDplus |
| 2-Hydroxypropyl 2-methyl-2-propenoate | ChemIDplus |
| beta-Hydroxypropyl methacrylate | ChemIDplus |
| 2-Hydroxypropylmethacrylate | ChemIDplus |
| β-Hydroxypropyl methacrylate | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| RS20100424 | Patent |
| US2011123702 | Patent |
| Citations |
|---|