EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N2O4 |
| Net Charge | 0 |
| Average Mass | 160.129 |
| Monoisotopic Mass | 160.04841 |
| SMILES | C/C(=C/NC(N)=O)C(=O)OO |
| InChI | InChI=1S/C5H8N2O4/c1-3(4(8)11-10)2-7-5(6)9/h2,10H,1H3,(H3,6,7,9)/b3-2- |
| InChIKey | GHIKATUDZMBUJC-IHWYPQMZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-2-methylureidoperacrylic acid (CHEBI:63249) has functional parent methacrylic acid (CHEBI:25219) |
| (Z)-2-methylureidoperacrylic acid (CHEBI:63249) is a peroxy acid (CHEBI:52094) |
| (Z)-2-methylureidoperacrylic acid (CHEBI:63249) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| (2Z)-3-(carbamoylamino)-2-methylprop-2-eneperoxoic acid |
| Synonym | Source |
|---|---|
| (Z)-2-methyl-ureidoacrylate peracid | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (Z)-2-methylureidoacrylate peracid | UniProt |
| Citations |
|---|