EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:53436 - ethylene glycol dimethacrylate
| Formula | C10H14O4 |
| Net Charge | 0 |
| Average Mass | 198.218 |
| Monoisotopic Mass | 198.08921 |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C10H14O4/c1-7(2)9(11)13-5-6-14-10(12)8(3)4/h1,3,5-6H2,2,4H3 |
| InChIKey | STVZJERGLQHEKB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | polymerisation monomer Any compound used as a monomer for a polymerisation process. The term is generally used in relation to industrial polymerisation processes. |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | cross-linking reagent A reagent with two reactive groups, usually at opposite ends of the molecule, that are capable of reacting with and thereby forming bridges between macromolecules, principally side chains of amino acids in proteins, allowing the locations of naturally reactive areas within the proteins to be identified. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylene glycol dimethacrylate (CHEBI:53436) has functional parent ethylene glycol (CHEBI:30742) |
| ethylene glycol dimethacrylate (CHEBI:53436) has functional parent methacrylic acid (CHEBI:25219) |
| ethylene glycol dimethacrylate (CHEBI:53436) has role allergen (CHEBI:50904) |
| ethylene glycol dimethacrylate (CHEBI:53436) has role cross-linking reagent (CHEBI:50684) |
| ethylene glycol dimethacrylate (CHEBI:53436) has role polymerisation monomer (CHEBI:74236) |
| ethylene glycol dimethacrylate (CHEBI:53436) is a enoate ester (CHEBI:51702) |
| IUPAC Name |
|---|
| ethane-1,2-diyl bis(2-methylacrylate) |
| Synonyms | Source |
|---|---|
| 1,2-Bis(methacryloyloxy)ethane | ChemIDplus |
| 1,2-Bis(Methacryloyloxy)ethane | NIST Chemistry WebBook |
| 1,2-Ethanediol dimethacrylate | NIST Chemistry WebBook |
| 1,2-Ethanediyl 2-methyl-2-propenoate | ChemIDplus |
| 2-(Methacryloyloxy)ethyl 2-methylacrylate | NIST Chemistry WebBook |
| 2-methyl-2-propenoic acid 1,2-ethanediyl ester | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Ethylene_glycol_dimethacrylate | Wikipedia |
| Citations |
|---|