EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | C=C(C)C(=O)OCCO |
| InChI | InChI=1S/C6H10O3/c1-5(2)6(8)9-4-3-7/h7H,1,3-4H2,2H3 |
| InChIKey | WOBHKFSMXKNTIM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | polymerisation monomer Any compound used as a monomer for a polymerisation process. The term is generally used in relation to industrial polymerisation processes. |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyethyl methacrylate (CHEBI:34288) has functional parent ethylene glycol (CHEBI:30742) |
| 2-hydroxyethyl methacrylate (CHEBI:34288) has functional parent methacrylic acid (CHEBI:25219) |
| 2-hydroxyethyl methacrylate (CHEBI:34288) has role allergen (CHEBI:50904) |
| 2-hydroxyethyl methacrylate (CHEBI:34288) has role polymerisation monomer (CHEBI:74236) |
| 2-hydroxyethyl methacrylate (CHEBI:34288) is a enoate ester (CHEBI:51702) |
| IUPAC Name |
|---|
| 2-hydroxyethyl methacrylate |
| Synonyms | Source |
|---|---|
| 1,2-Ethanediol mono(2-methyl)-2-propenoate | NIST Chemistry WebBook |
| 2-Hydroxyethyl 2-methylacrylate | NIST Chemistry WebBook |
| 2-Hydroxyethyl methacrylate | KEGG COMPOUND |
| 2-Hydroxyethylmethacrylate | ChemIDplus |
| 2-(Methacryloyloxy)ethanol | ChemIDplus |
| Ethylene glycol methacrylate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14530 | KEGG COMPOUND |
| (Hydroxyethyl)methacrylate | Wikipedia |
| Citations |
|---|