EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N2O3 |
| Net Charge | 0 |
| Average Mass | 144.130 |
| Monoisotopic Mass | 144.05349 |
| SMILES | C/C(=C/NC(N)=O)C(=O)O |
| InChI | InChI=1S/C5H8N2O3/c1-3(4(8)9)2-7-5(6)10/h2H,1H3,(H,8,9)(H3,6,7,10)/b3-2- |
| InChIKey | XHTOIFCGKIBYRK-IHWYPQMZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-2-methylureidoacrylic acid (CHEBI:143867) has functional parent methacrylic acid (CHEBI:25219) |
| (Z)-2-methylureidoacrylic acid (CHEBI:143867) has functional parent uracil (CHEBI:17568) |
| (Z)-2-methylureidoacrylic acid (CHEBI:143867) is a monocarboxylic acid (CHEBI:25384) |
| (Z)-2-methylureidoacrylic acid (CHEBI:143867) is a ureas (CHEBI:47857) |
| (Z)-2-methylureidoacrylic acid (CHEBI:143867) is conjugate acid of (Z)-2-methylureidoacrylate (CHEBI:143783) |
| Incoming Relation(s) |
| (Z)-2-methylureidoacrylate (CHEBI:143783) is conjugate base of (Z)-2-methylureidoacrylic acid (CHEBI:143867) |
| IUPAC Name |
|---|
| (2Z)-3-(carbamoylamino)-2-methylacrylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-22331 | MetaCyc |
| Citations |
|---|