EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO2 |
| Net Charge | 0 |
| Average Mass | 101.105 |
| Monoisotopic Mass | 101.04768 |
| SMILES | C/C(=C/N)C(=O)O |
| InChI | InChI=1S/C4H7NO2/c1-3(2-5)4(6)7/h2H,5H2,1H3,(H,6,7)/b3-2- |
| InChIKey | SQNWFKZOFAOCHM-IHWYPQMZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-3-amino-2-methylacrylic acid (CHEBI:145742) has functional parent methacrylic acid (CHEBI:25219) |
| (Z)-3-amino-2-methylacrylic acid (CHEBI:145742) is a enamine (CHEBI:47989) |
| (Z)-3-amino-2-methylacrylic acid (CHEBI:145742) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (Z)-3-amino-2-methylacrylic acid (CHEBI:145742) is conjugate acid of (Z)-3-amino-2-methylacrylate (CHEBI:145735) |
| Incoming Relation(s) |
| (Z)-2-methyl-3-aminoperacrylic acid (CHEBI:63250) has functional parent (Z)-3-amino-2-methylacrylic acid (CHEBI:145742) |
| (Z)-3-amino-2-methylacrylate (CHEBI:145735) is conjugate base of (Z)-3-amino-2-methylacrylic acid (CHEBI:145742) |
| IUPAC Name |
|---|
| (2Z)-3-amino-2-methylacrylic acid |
| Synonym | Source |
|---|---|
| (Z)-2-methylaminoacrylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-22332 | MetaCyc |
| Citations |
|---|