EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O2 |
| Net Charge | 0 |
| Average Mass | 100.117 |
| Monoisotopic Mass | 100.05243 |
| SMILES | C=C(C)C(=O)OC |
| InChI | InChI=1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3 |
| InChIKey | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | polymerisation monomer Any compound used as a monomer for a polymerisation process. The term is generally used in relation to industrial polymerisation processes. |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl methacrylate (CHEBI:34840) has functional parent methacrylic acid (CHEBI:25219) |
| methyl methacrylate (CHEBI:34840) has role allergen (CHEBI:50904) |
| methyl methacrylate (CHEBI:34840) has role polymerisation monomer (CHEBI:74236) |
| methyl methacrylate (CHEBI:34840) is a enoate ester (CHEBI:51702) |
| methyl methacrylate (CHEBI:34840) is a methyl ester (CHEBI:25248) |
| Synonyms | Source |
|---|---|
| 2-(Methoxycarbonyl)-1-propene | ChemIDplus |
| 2-Methyl-2-propenoic acid methyl ester | ChemIDplus |
| 2-Methylacrylic acid methyl ester | ChemIDplus |
| Methacrylate de methyle | ChemIDplus |
| Methacrylic acid methyl ester | ChemIDplus |
| Methacrylsäuremethyl ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14527 | KEGG COMPOUND |
| HMDB0032385 | HMDB |
| Methyl_methacrylate | Wikipedia |
| Citations |
|---|