EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:36090 - 4-coumaric acid
| Formula | C9H8O3 |
| Net Charge | 0 |
| Average Mass | 164.160 |
| Monoisotopic Mass | 164.04734 |
| SMILES | [H]C(=Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12) |
| InChIKey | NGSWKAQJJWESNS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-coumaric acid (CHEBI:36090) has role plant metabolite (CHEBI:76924) |
| 4-coumaric acid (CHEBI:36090) is a coumaric acid (CHEBI:23401) |
| 4-coumaric acid (CHEBI:36090) is conjugate acid of 4-coumarate (CHEBI:32373) |
| Incoming Relation(s) |
| N1,N5,N10-tri-p-coumaroyl spermidine (CHEBI:61514) has functional parent 4-coumaric acid (CHEBI:36090) |
| p-coumaroylagmatine (CHEBI:32818) has functional parent 4-coumaric acid (CHEBI:36090) |
| p-coutaric acid (CHEBI:77439) has functional parent 4-coumaric acid (CHEBI:36090) |
| 2-(p-coumaroyl)malic acid (CHEBI:134253) has functional parent 4-coumaric acid (CHEBI:36090) |
| 3-(2-methoxyphenyl)-2-propenoic acid (CHEBI:93692) has functional parent 4-coumaric acid (CHEBI:36090) |
| 3-p-coumaroylquinic acid (CHEBI:75499) has functional parent 4-coumaric acid (CHEBI:36090) |
| 4-O-β-D-glucosyl-4-coumaric acid (CHEBI:17335) has functional parent 4-coumaric acid (CHEBI:36090) |
| 4-p-coumaroylquinic acid (CHEBI:1945) has functional parent 4-coumaric acid (CHEBI:36090) |
| 4-coumaric acid methyl ester (CHEBI:86904) has functional parent 4-coumaric acid (CHEBI:36090) |
| 4-coumaroyl-CoA (CHEBI:15499) has functional parent 4-coumaric acid (CHEBI:36090) |
| 5-p-coumaroylquinic acid (CHEBI:75500) has functional parent 4-coumaric acid (CHEBI:36090) |
| 7-O-(6-p-coumaroylglucosyl)chrysoeriol (CHEBI:75509) has functional parent 4-coumaric acid (CHEBI:36090) |
| bisdemethoxycurcumin (CHEBI:71045) has functional parent 4-coumaric acid (CHEBI:36090) |
| cadabicine sulfate (CHEBI:132716) has functional parent 4-coumaric acid (CHEBI:36090) |
| Pestalotiopisorin A (CHEBI:207973) has functional parent 4-coumaric acid (CHEBI:36090) |
| spermidine hydroxycinnamic acid conjugate (CHEBI:61233) has functional parent 4-coumaric acid (CHEBI:36090) |
| cis-4-coumaric acid (CHEBI:17450) is a 4-coumaric acid (CHEBI:36090) |
| trans-4-coumaric acid (CHEBI:32374) is a 4-coumaric acid (CHEBI:36090) |
| 4-coumarate (CHEBI:32373) is conjugate base of 4-coumaric acid (CHEBI:36090) |
| IUPAC Name |
|---|
| 3-(4-hydroxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 3-(4-hydroxyphenyl)-2-propenoic acid | ChemIDplus |
| 3-(4-hydroxyphenyl)acrylic acid | ChEBI |
| 4-coumaric acid | ChemIDplus |
| 4-hydroxycinnamic acid | ChemIDplus |
| 4'-hydroxycinnamic acid | NIST Chemistry WebBook |
| para-coumaric acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 4-coumaric_acid | Wikipedia |
| Citations |
|---|