EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O8 |
| Net Charge | 0 |
| Average Mass | 296.231 |
| Monoisotopic Mass | 296.05322 |
| SMILES | [H]C(=CC(=O)OC(C(=O)O)C(O)C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H12O8/c14-8-4-1-7(2-5-8)3-6-9(15)21-11(13(19)20)10(16)12(17)18/h1-6,10-11,14,16H,(H,17,18)(H,19,20) |
| InChIKey | INYJZRKTYXTZHP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-coutaric acid (CHEBI:77439) has functional parent 4-coumaric acid (CHEBI:36090) |
| p-coutaric acid (CHEBI:77439) is a cinnamate ester (CHEBI:36087) |
| p-coutaric acid (CHEBI:77439) is a dicarboxylic acid (CHEBI:35692) |
| p-coutaric acid (CHEBI:77439) is a phenols (CHEBI:33853) |
| p-coutaric acid (CHEBI:77439) is a tetraric acid derivative (CHEBI:63440) |
| Incoming Relation(s) |
| (2R,3S)-cis-coutaric acid (CHEBI:76096) is a p-coutaric acid (CHEBI:77439) |
| (2R,3S)-trans-coutaric acid (CHEBI:76095) is a p-coutaric acid (CHEBI:77439) |
| IUPAC Name |
|---|
| 2-hydroxy-3-{[3-(4-hydroxyphenyl)prop-2-enoyl]oxy}succinic acid |
| Synonym | Source |
|---|---|
| coutaric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Coutaric_acid | Wikipedia |
| HMDB0029225 | HMDB |
| Citations |
|---|