EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:17450 - cis-4-coumaric acid
| Formula | C9H8O3 |
| Net Charge | 0 |
| Average Mass | 164.160 |
| Monoisotopic Mass | 164.04734 |
| SMILES | O=C(O)/C=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3- |
| InChIKey | NGSWKAQJJWESNS-UTCJRWHESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-4-coumaric acid (CHEBI:17450) is a 4-coumaric acid (CHEBI:36090) |
| cis-4-coumaric acid (CHEBI:17450) is conjugate acid of cis-4-coumarate (CHEBI:58152) |
| Incoming Relation(s) |
| (Z)-p-coumaroylagmatine (CHEBI:86085) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| (2R,3S)-cis-coutaric acid (CHEBI:76096) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| 3-O-(cis-4-coumaroyl)-β-D-glucopyranose (CHEBI:76093) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| asprellic acid C (CHEBI:65456) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| brevipolide B (CHEBI:65523) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| cyanidin 3-O-{6-O-[(Z)-4-coumaroyl]-β-D-glucoside} (CHEBI:131451) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| delphinidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75675) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| luzonial B (CHEBI:66599) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| luzonidial B (CHEBI:66600) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| malvidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75691) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| peonidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75706) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| petunidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75708) has functional parent cis-4-coumaric acid (CHEBI:17450) |
| cis-4-coumarate (CHEBI:58152) is conjugate base of cis-4-coumaric acid (CHEBI:17450) |
| IUPAC Name |
|---|
| (2Z)-3-(4-hydroxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| (2Z)-3-(4-hydroxyphenyl)acrylic acid | ChEBI |
| cis-p-Coumarate | KEGG COMPOUND |
| cis-4-hydroxycinnamic acid | ChemIDplus |
| cis-p-coumaric acid | ChemIDplus |
| cis-p-coumarinic acid | ChemIDplus |
| cis-p-hydroxycinnamic acid | ChemIDplus |