EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O5 |
| Net Charge | 0 |
| Average Mass | 262.261 |
| Monoisotopic Mass | 262.08412 |
| SMILES | C[C@H]1OC(=O)c2c(ccc(/C=C/C(=O)O)c2O)[C@@H]1C |
| InChI | InChI=1S/C14H14O5/c1-7-8(2)19-14(18)12-10(7)5-3-9(13(12)17)4-6-11(15)16/h3-8,17H,1-2H3,(H,15,16)/b6-4+/t7-,8-/m1/s1 |
| InChIKey | XSYRDVCSKQJINC-CTDODENGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsisspecies (ncbitaxon:36460) | - | DOI (10.1016/j.tetlet.2010.10.131) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pestalotiopisorin A (CHEBI:207973) has functional parent 4-coumaric acid (CHEBI:36090) |
| Pestalotiopisorin A (CHEBI:207973) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-[(3R,4S)-8-hydroxy-3,4-dimethyl-1-oxo-3,4-dihydroisochromen-7-yl]prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437905 | ChemSpider |