EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O8 |
| Net Charge | 0 |
| Average Mass | 338.312 |
| Monoisotopic Mass | 338.10017 |
| SMILES | [H]C(=CC(=O)O[C@H]1[C@H](O)C[C@](O)(C(=O)O)C[C@H]1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H18O8/c17-10-4-1-9(2-5-10)3-6-13(20)24-14-11(18)7-16(23,15(21)22)8-12(14)19/h1-6,11-12,14,17-19,23H,7-8H2,(H,21,22)/t11-,12-,14-,16+/m1/s1 |
| InChIKey | XWRHBGVVCOSNKO-NCZKRNLISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | - | PubMed (26988497) | |
| Cydonia oblonga (ncbitaxon:36610) | - | PubMed (28490099) | Isolated from peel and pulp. |
| Lophatherum gracile (ncbitaxon:29683) | - | PubMed (25527702) | |
| Nicotiana tabacum (ncbitaxon:4097) | - | DOI (10.1016/j.plantsci.2011.02.009) | |
| Brassica oleracea var. costata (ncbitaxon:416546) | leaf (BTO:0000713) | DOI (10.1007/s00217-005-0104-0) | |
| Juglans regia (ncbitaxon:51240) | leaf (BTO:0000713) | DOI (10.1016/j.foodchem.2004.01.055) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-p-coumaroylquinic acid (CHEBI:1945) has functional parent (−)-quinic acid (CHEBI:17521) |
| 4-p-coumaroylquinic acid (CHEBI:1945) has functional parent 4-coumaric acid (CHEBI:36090) |
| 4-p-coumaroylquinic acid (CHEBI:1945) has role plant metabolite (CHEBI:76924) |
| 4-p-coumaroylquinic acid (CHEBI:1945) is a cinnamate ester (CHEBI:36087) |
| 4-p-coumaroylquinic acid (CHEBI:1945) is a cyclitol carboxylic acid (CHEBI:36123) |
| Incoming Relation(s) |
| trans-4-p-coumaroylquinic acid (CHEBI:176887) is a 4-p-coumaroylquinic acid (CHEBI:1945) |
| IUPAC Name |
|---|
| (1S,3R,4S,5R)-1,3,5-trihydroxy-4-{[3-(4-hydroxyphenyl)prop-2-enoyl]oxy}cyclohexanecarboxylic acid |
| Synonyms | Source |
|---|---|
| 4-coumaroylquinic acid | ChEBI |
| 4-O-coumaroylquinic acid | ChEBI |
| 4-O-p-coumaroylquinic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2706509 | Reaxys |
| CAS:93451-44-6 | KEGG COMPOUND |
| CAS:93451-44-6 | ChemIDplus |
| Citations |
|---|