EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O8 |
| Net Charge | 0 |
| Average Mass | 338.312 |
| Monoisotopic Mass | 338.10017 |
| SMILES | [H]C(=Cc1ccc(O)cc1)C(=O)O[C@@H]1C[C@@](O)(C(=O)O)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H18O8/c17-10-4-1-9(2-5-10)3-6-13(19)24-12-8-16(23,15(21)22)7-11(18)14(12)20/h1-6,11-12,14,17-18,20,23H,7-8H2,(H,21,22)/t11-,12-,14+,16-/m1/s1 |
| InChIKey | BMRSEYFENKXDIS-UNIGVISCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-p-coumaroylquinic acid (CHEBI:75499) has functional parent (−)-quinic acid (CHEBI:17521) |
| 3-p-coumaroylquinic acid (CHEBI:75499) has functional parent 4-coumaric acid (CHEBI:36090) |
| 3-p-coumaroylquinic acid (CHEBI:75499) has role metabolite (CHEBI:25212) |
| 3-p-coumaroylquinic acid (CHEBI:75499) is a cinnamate ester (CHEBI:36087) |
| 3-p-coumaroylquinic acid (CHEBI:75499) is a cyclitol carboxylic acid (CHEBI:36123) |
| IUPAC Name |
|---|
| (1R,3R,4S,5R)-1,3,4-trihydroxy-5-{[3-(4-hydroxyphenyl)prop-2-enoyl]oxy}cyclohexanecarboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2706507 | Reaxys |