EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O7 |
| Net Charge | 0 |
| Average Mass | 280.232 |
| Monoisotopic Mass | 280.05830 |
| SMILES | O=C(O)CC(OC(=O)C=Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C13H12O7/c14-9-4-1-8(2-5-9)3-6-12(17)20-10(13(18)19)7-11(15)16/h1-6,10,14H,7H2,(H,15,16)(H,18,19) |
| InChIKey | QVPHNABUSKBIMG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | MetaboLights (MTBLS198) | ||
| urine (BTO:0001419) | DOI (10.1007/s11306-015-0935-z) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(p-coumaroyl)malic acid (CHEBI:134253) has functional parent 4-coumaric acid (CHEBI:36090) |
| 2-(p-coumaroyl)malic acid (CHEBI:134253) has functional parent malic acid (CHEBI:6650) |
| 2-(p-coumaroyl)malic acid (CHEBI:134253) has role human urinary metabolite (CHEBI:84087) |
| 2-(p-coumaroyl)malic acid (CHEBI:134253) is a carboxylic ester (CHEBI:33308) |
| 2-(p-coumaroyl)malic acid (CHEBI:134253) is a dicarboxylic acid (CHEBI:35692) |
| 2-(p-coumaroyl)malic acid (CHEBI:134253) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-{[3-(4-hydroxyphenyl)acryloyl]oxy}butanedioic acid |
| Synonyms | Source |
|---|---|
| 2-(4-coumaroyl)malic acid | ChEBI |
| p-coumaroyl malic acid | ChEBI |
| O-(p-coumaroyl)malic acid | ChEBI |
| O-(4-coumaroyl)malic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27425998 | Reaxys |