EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O4 |
| Net Charge | 0 |
| Average Mass | 308.333 |
| Monoisotopic Mass | 308.10486 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)CC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C19H16O4/c20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h1-12,20-21H,13H2/b11-5+,12-6+ |
| InChIKey | PREBVFJICNPEKM-YDWXAUTNSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.1 (alpha-amylase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-amylase (EC 3.2.1.1). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisdemethoxycurcumin (CHEBI:71045) has functional parent 4-coumaric acid (CHEBI:36090) |
| bisdemethoxycurcumin (CHEBI:71045) has role EC 3.2.1.1 (α-amylase) inhibitor (CHEBI:50627) |
| bisdemethoxycurcumin (CHEBI:71045) has role metabolite (CHEBI:25212) |
| bisdemethoxycurcumin (CHEBI:71045) is a diarylheptanoid (CHEBI:78802) |
| bisdemethoxycurcumin (CHEBI:71045) is a enone (CHEBI:51689) |
| bisdemethoxycurcumin (CHEBI:71045) is a polyphenol (CHEBI:26195) |
| bisdemethoxycurcumin (CHEBI:71045) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| (1E,6E)-1,7-bis(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| Synonyms | Source |
|---|---|
| Curcumin III | ChemIDplus |
| Bis(p-hydroxycinnamoyl)methane | ChemIDplus |
| Didemethoxycurcumin | ChemIDplus |
| Bis(4-hydroxycinnamoyl)methane | ChemIDplus |
| 1,7-Bis(4-hydroxyphenyl)-1,6-Heptadiene-3,5-dione | HMDB |
| UniProt Name | Source |
|---|---|
| bisdemethoxycurcumin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C17743 | KEGG COMPOUND |
| US2010048957 | Patent |
| US2006258752 | Patent |
| WO2007011674 | Patent |
| CPD-12188 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3149384 | Reaxys |
| CAS:24939-16-0 | KEGG COMPOUND |
| CAS:33171-05-0 | ChemIDplus |
| CAS:24939-16-0 | ChemIDplus |
| Citations |
|---|