EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O4 |
| Net Charge | 0 |
| Average Mass | 308.333 |
| Monoisotopic Mass | 308.10486 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)CC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C19H16O4/c20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h1-12,20-21H,13H2/b11-5+,12-6+ |
| InChIKey | PREBVFJICNPEKM-YDWXAUTNSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.2.1.1 (alpha-amylase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-amylase (EC 3.2.1.1). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisdemethoxycurcumin (CHEBI:71045) has functional parent 4-coumaric acid (CHEBI:36090) |
| bisdemethoxycurcumin (CHEBI:71045) has role EC 3.2.1.1 (α-amylase) inhibitor (CHEBI:50627) |
| bisdemethoxycurcumin (CHEBI:71045) has role metabolite (CHEBI:25212) |
| bisdemethoxycurcumin (CHEBI:71045) is a diarylheptanoid (CHEBI:78802) |
| bisdemethoxycurcumin (CHEBI:71045) is a enone (CHEBI:51689) |
| bisdemethoxycurcumin (CHEBI:71045) is a polyphenol (CHEBI:26195) |
| bisdemethoxycurcumin (CHEBI:71045) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| (1E,6E)-1,7-bis(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| Synonyms | Source |
|---|---|
| 1,7-Bis(4-hydroxyphenyl)-1,6-Heptadiene-3,5-dione | HMDB |
| Bis(4-hydroxycinnamoyl)methane | ChemIDplus |
| Bis(p-hydroxycinnamoyl)methane | ChemIDplus |
| Curcumin III | ChemIDplus |
| Didemethoxycurcumin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| bisdemethoxycurcumin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C17743 | KEGG COMPOUND |
| CPD-12188 | MetaCyc |
| US2006258752 | Patent |
| US2010048957 | Patent |
| WO2007011674 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3149384 | Reaxys |
| CAS:24939-16-0 | KEGG COMPOUND |
| CAS:24939-16-0 | ChemIDplus |
| CAS:33171-05-0 | ChemIDplus |
| Citations |
|---|