EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O3 |
| Net Charge | 0 |
| Average Mass | 178.187 |
| Monoisotopic Mass | 178.06299 |
| SMILES | COc1ccccc1C=CC(=O)O |
| InChI | InChI=1S/C10H10O3/c1-13-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3,(H,11,12) |
| InChIKey | FEGVSPGUHMGGBO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(2-methoxyphenyl)-2-propenoic acid (CHEBI:93692) has functional parent 4-coumaric acid (CHEBI:36090) |
| 3-(2-methoxyphenyl)-2-propenoic acid (CHEBI:93692) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| LSM-4173 | LINCS |