EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29N3O7S |
| Net Charge | 0 |
| Average Mass | 515.588 |
| Monoisotopic Mass | 515.17262 |
| SMILES | O=C1/C=C/c2ccc(OS(=O)(=O)O)c(c2)Oc2ccc(cc2)/C=C/C(=O)NCCCNCCCCN1 |
| InChI | InChI=1S/C25H29N3O7S/c29-24-12-7-19-4-9-21(10-5-19)34-23-18-20(6-11-22(23)35-36(31,32)33)8-13-25(30)27-16-2-1-14-26-15-3-17-28-24/h4-13,18,26H,1-3,14-17H2,(H,27,30)(H,28,29)(H,31,32,33)/b12-7+,13-8+ |
| InChIKey | HVFBFUUUEIXKJL-INOXDZRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | MetaboLights (MTBLS338) | ||
| root (BTO:0001188) | PubMed (27363486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cadabicine sulfate (CHEBI:132716) has functional parent 4-coumaric acid (CHEBI:36090) |
| cadabicine sulfate (CHEBI:132716) has role plant metabolite (CHEBI:76924) |
| cadabicine sulfate (CHEBI:132716) is a aromatic ether (CHEBI:35618) |
| cadabicine sulfate (CHEBI:132716) is a aryl sulfate (CHEBI:37919) |
| cadabicine sulfate (CHEBI:132716) is a azamacrocycle (CHEBI:52898) |
| cadabicine sulfate (CHEBI:132716) is a cyclic ether (CHEBI:37407) |
| cadabicine sulfate (CHEBI:132716) is a enamide (CHEBI:51751) |
| cadabicine sulfate (CHEBI:132716) is a secondary amino compound (CHEBI:50995) |
| cadabicine sulfate (CHEBI:132716) is a secondary carboxamide (CHEBI:140325) |
| cadabicine sulfate (CHEBI:132716) is a spermidine alkaloid (CHEBI:38524) |
| IUPAC Name |
|---|
| (8E,22E)-10,21-dioxo-2-oxa-11,16,20-triazatricyclo[22.2.2.13,7]nonacosa-1(26),3(29),4,6,8,22,24,27-octaen-4-yl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| didehydro-di(coumaroyl) spermidine sulfate | ChEBI |
| cyclic didehydro-di(coumaroyl)spermidine sulfate | ChEBI |
| Citations |
|---|