EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:38655 - (S)-2-methylbutyric acid
| Formula | C5H10O2 |
| Net Charge | 0 |
| Average Mass | 102.133 |
| Monoisotopic Mass | 102.06808 |
| SMILES | CC[C@H](C)C(=O)O |
| InChI | InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/t4-/m0/s1 |
| InChIKey | WLAMNBDJUVNPJU-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-methylbutyric acid (CHEBI:38655) is a 2-methylbutyric acid (CHEBI:37070) |
| (S)-2-methylbutyric acid (CHEBI:38655) is conjugate acid of (S)-2-methylbutanoate (CHEBI:145932) |
| (S)-2-methylbutyric acid (CHEBI:38655) is enantiomer of (R)-2-methylbutyric acid (CHEBI:45525) |
| Incoming Relation(s) |
| (S)-2-methylbutanoyl-CoA (CHEBI:90222) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| egonol-2'''-methyl butanoate (CHEBI:69550) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| lovastatin (CHEBI:40303) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| mevinolinic acid (CHEBI:82985) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| pescaprein XXI (CHEBI:67851) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| pescaprein XXII (CHEBI:67852) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| pescaprein XXIII (CHEBI:67853) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| pescaprein XXIV (CHEBI:67854) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| pescaprein XXIX (CHEBI:67859) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| pescaprein XXVII (CHEBI:67857) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| pescaprein XXVIII (CHEBI:67858) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| pescaprein XXX (CHEBI:67860) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| pravastatin (CHEBI:63618) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| pravastatin lactone (CHEBI:145933) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| (S)-2-methylbutanoate (CHEBI:145932) is conjugate base of (S)-2-methylbutyric acid (CHEBI:38655) |
| (R)-2-methylbutyric acid (CHEBI:45525) is enantiomer of (S)-2-methylbutyric acid (CHEBI:38655) |
| IUPAC Name |
|---|
| (2S)-2-methylbutanoic acid |
| Synonyms | Source |
|---|---|
| (S)-2-methylbutanoic acid | NIST Chemistry WebBook |
| (S)-α-methylbutanoic acid | ChEBI |
| Citations |
|---|