EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44N7O17P3S |
| Net Charge | 0 |
| Average Mass | 851.659 |
| Monoisotopic Mass | 851.17272 |
| SMILES | CC[C@H](C)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C26H44N7O17P3S/c1-5-14(2)25(38)54-9-8-28-16(34)6-7-29-23(37)20(36)26(3,4)11-47-53(44,45)50-52(42,43)46-10-15-19(49-51(39,40)41)18(35)24(48-15)33-13-32-17-21(27)30-12-31-22(17)33/h12-15,18-20,24,35-36H,5-11H2,1-4H3,(H,28,34)(H,29,37)(H,42,43)(H,44,45)(H2,27,30,31)(H2,39,40,41)/t14-,15+,18+,19+,20-,24+/m0/s1 |
| InChIKey | LYNVNYDEQMMNMZ-JRQZLUQRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-methylbutanoyl-CoA (CHEBI:90222) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| (S)-2-methylbutanoyl-CoA (CHEBI:90222) has role mouse metabolite (CHEBI:75771) |
| (S)-2-methylbutanoyl-CoA (CHEBI:90222) is a (2S)-2-methylacyl-CoA (CHEBI:15451) |
| (S)-2-methylbutanoyl-CoA (CHEBI:90222) is a 2-methylbutanoyl-CoA (CHEBI:15477) |
| (S)-2-methylbutanoyl-CoA (CHEBI:90222) is conjugate acid of (S)-2-methylbutanoyl-CoA(4−) (CHEBI:88166) |
| Incoming Relation(s) |
| (S)-2-methylbutanoyl-CoA(4−) (CHEBI:88166) is conjugate base of (S)-2-methylbutanoyl-CoA (CHEBI:90222) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-({3-[(2-{[(2S)-2-methylbutanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| (S)-2-methylbutyryl-CoA | ChEBI |
| (S)-2-methylbutanoyl-coenzyme A | ChEBI |
| (S)-2-methylbutyryl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15980 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19754696 | Reaxys |