EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O5 |
| Net Charge | 0 |
| Average Mass | 404.547 |
| Monoisotopic Mass | 404.25627 |
| SMILES | [H][C@@]12C(=C[C@H](C)C[C@@H]1OC(=O)[C@@H](C)CC)C=C[C@H](C)[C@@H]2CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C24H36O5/c1-5-15(3)24(27)29-21-11-14(2)10-17-7-6-16(4)20(23(17)21)9-8-19-12-18(25)13-22(26)28-19/h6-7,10,14-16,18-21,23,25H,5,8-9,11-13H2,1-4H3/t14-,15-,16-,18+,19+,20-,21-,23-/m0/s1 |
| InChIKey | PCZOHLXUXFIOCF-BXMDZJJMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antirheumatic drug A drug used to treat rheumatoid arthritis. anticholesteremic drug A substance used to lower plasma cholesterol levels. antiparkinson drug A drug used in the treatment of Parkinson's disease. anti-asthmatic agent Any compound that has anti-asthmatic effects. anti-inflammatory agent Any compound that has anti-inflammatory effects. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. anticholesteremic drug A substance used to lower plasma cholesterol levels. anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lovastatin (CHEBI:40303) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| lovastatin (CHEBI:40303) has functional parent mevastatin (CHEBI:34848) |
| lovastatin (CHEBI:40303) has role Aspergillus metabolite (CHEBI:76956) |
| lovastatin (CHEBI:40303) has role anti-asthmatic agent (CHEBI:65023) |
| lovastatin (CHEBI:40303) has role anti-HIV agent (CHEBI:64946) |
| lovastatin (CHEBI:40303) has role anti-inflammatory agent (CHEBI:67079) |
| lovastatin (CHEBI:40303) has role antiatherosclerotic agent (CHEBI:145947) |
| lovastatin (CHEBI:40303) has role anticholesteremic drug (CHEBI:35821) |
| lovastatin (CHEBI:40303) has role antineoplastic agent (CHEBI:35610) |
| lovastatin (CHEBI:40303) has role antiparkinson drug (CHEBI:48407) |
| lovastatin (CHEBI:40303) has role antirheumatic drug (CHEBI:35842) |
| lovastatin (CHEBI:40303) has role cardiovascular drug (CHEBI:35554) |
| lovastatin (CHEBI:40303) has role prodrug (CHEBI:50266) |
| lovastatin (CHEBI:40303) is a fatty acid ester (CHEBI:35748) |
| lovastatin (CHEBI:40303) is a hexahydronaphthalenes (CHEBI:142348) |
| lovastatin (CHEBI:40303) is a polyketide (CHEBI:26188) |
| lovastatin (CHEBI:40303) is a statin (naturally occurring) (CHEBI:87632) |
| lovastatin (CHEBI:40303) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| mevinolinic acid (CHEBI:82985) has functional parent lovastatin (CHEBI:40303) |
| simvastatin (CHEBI:9150) has functional parent lovastatin (CHEBI:40303) |
| xuezhikang (CHEBI:231891) has part lovastatin (CHEBI:40303) |
| IUPAC Name |
|---|
| (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2S)-2-methylbutanoate |
| INNs | Source |
|---|---|
| lovastatina | WHO MedNet |
| lovastatine | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1S,3R,7S,8S,8aR)-1,2,3,7,8,8a-hexahydro-3,7-dimethyl-8-(2-(2R,4R)-(tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl)ethyl)-1-naphthalenyl (S)-2-methyl-butyrate | ChemIDplus |
| 2β,6α-dimethyl-8alpha-(2-methyl-1-oxobutoxy)-mevinic acid lactone | ChemIDplus |
| 6.alpha.-methylcompactin | ChEMBL |
| 6α-methylcompactin | ChemIDplus |
| C10AA02 | ChEMBL |
| L-154803 | ChEMBL |
| Brand Names | Source |
|---|---|
| Altoprev | ChEMBL |
| Lovastatin component of advicor | ChEMBL |
| Mevacor | ChemIDplus |
| Mevinacor | ChEMBL |
| Mevinacor 10 | ChEMBL |
| Mevinacor 40 | ChEMBL |
| UniProt Name | Source |
|---|---|
| lovastatin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1612 | DrugCentral |
| 803 | PDBeChem |
| C00000547 | KNApSAcK |
| C07074 | KEGG COMPOUND |
| CN103172602 | Patent |
| D00359 | KEGG DRUG |
| DB00227 | DrugBank |
| HMDB0014372 | HMDB |
| Lovastatin | Wikipedia |
| LSM-2189 | LINCS |
| WO2013090461 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3631989 | Beilstein |
| Reaxys:4720754 | Reaxys |
| CAS:75330-75-5 | KEGG DRUG |
| CAS:75330-75-5 | ChemIDplus |
| Citations |
|---|