EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O6 |
| Net Charge | 0 |
| Average Mass | 410.466 |
| Monoisotopic Mass | 410.17294 |
| SMILES | CC[C@H](C)C(=O)OCCCc1cc(OC)c2oc(-c3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C24H26O6/c1-4-15(2)24(25)27-9-5-6-16-10-18-13-20(30-23(18)22(11-16)26-3)17-7-8-19-21(12-17)29-14-28-19/h7-8,10-13,15H,4-6,9,14H2,1-3H3/t15-/m0/s1 |
| InChIKey | MGCSMWCSVJYFBV-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Styrax agrestis (ncbitaxon:153522) | ripe fruit (PO:0007038) | PubMed (21939219) | Dried, powdered fruits were extracted with ethylacetate. |
| Styrax obassia (ncbitaxon:153542) | - | PubMed (21939219) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| egonol-2'''-methyl butanoate (CHEBI:69550) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| egonol-2'''-methyl butanoate (CHEBI:69550) has functional parent egonol (CHEBI:69558) |
| egonol-2'''-methyl butanoate (CHEBI:69550) has parent hydride 1-benzofuran (CHEBI:35260) |
| egonol-2'''-methyl butanoate (CHEBI:69550) has role plant metabolite (CHEBI:76924) |
| egonol-2'''-methyl butanoate (CHEBI:69550) is a 1-benzofurans (CHEBI:38830) |
| egonol-2'''-methyl butanoate (CHEBI:69550) is a aromatic ether (CHEBI:35618) |
| egonol-2'''-methyl butanoate (CHEBI:69550) is a benzodioxoles (CHEBI:38298) |
| egonol-2'''-methyl butanoate (CHEBI:69550) is a fatty acid ester (CHEBI:35748) |
| Incoming Relation(s) |
| 7-demethoxylegonol-2-methylbutanoate (CHEBI:69551) has functional parent egonol-2'''-methyl butanoate (CHEBI:69550) |
| IUPAC Name |
|---|
| 3-[2-(1,3-benzodioxol-5-yl)-7-methoxy-1-benzofuran-5-yl]propyl (2S)-2-methylbutanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22007790 | Reaxys |
| Citations |
|---|