EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O2 |
| Net Charge | 0 |
| Average Mass | 102.133 |
| Monoisotopic Mass | 102.06808 |
| SMILES | CCC(C)C(=O)O |
| InChI | InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7) |
| InChIKey | WLAMNBDJUVNPJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylbutyric acid (CHEBI:37070) has role bacterial metabolite (CHEBI:76969) |
| 2-methylbutyric acid (CHEBI:37070) has role human metabolite (CHEBI:77746) |
| 2-methylbutyric acid (CHEBI:37070) is a methylbutyric acid (CHEBI:38653) |
| 2-methylbutyric acid (CHEBI:37070) is conjugate acid of 2-methylbutyrate (CHEBI:48946) |
| Incoming Relation(s) |
| N-(2-methylbutanoyl)glycine (CHEBI:86366) has functional parent 2-methylbutyric acid (CHEBI:37070) |
| 1S,6R-di(2-)methylbutanoyloxy-4S-hydroxy-8S-benzoyloxy-9R-(3-)furancarbonyloxy-13-acetyloxy-β-dihydroagarofuran (CHEBI:65878) has functional parent 2-methylbutyric acid (CHEBI:37070) |
| 2-hydroxy-2-methylbutyric acid (CHEBI:68454) has functional parent 2-methylbutyric acid (CHEBI:37070) |
| 2-methylbutanoyl-CoA (CHEBI:15477) has functional parent 2-methylbutyric acid (CHEBI:37070) |
| 2-methylbutyrylcarnitine (CHEBI:73026) has functional parent 2-methylbutyric acid (CHEBI:37070) |
| ethyl 2-methylbutyrate (CHEBI:88452) has functional parent 2-methylbutyric acid (CHEBI:37070) |
| trichanolide (CHEBI:68370) has functional parent 2-methylbutyric acid (CHEBI:37070) |
| (R)-2-methylbutyric acid (CHEBI:45525) is a 2-methylbutyric acid (CHEBI:37070) |
| (S)-2-methylbutyric acid (CHEBI:38655) is a 2-methylbutyric acid (CHEBI:37070) |
| 2-methylbutyrate (CHEBI:48946) is conjugate base of 2-methylbutyric acid (CHEBI:37070) |
| IUPAC Name |
|---|
| 2-methylbutanoic acid |
| Synonyms | Source |
|---|---|
| 2-methybutyric acid | ChemIDplus |
| 2-methylbutyric acid | NIST Chemistry WebBook |
| 2-Methylbutyric acid | KEGG COMPOUND |
| butane-2-carboxylic acid | ChEBI |
| ethylmethylacetic acid | ChemIDplus |
| methylethylacetic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C18319 | KEGG COMPOUND |
| DB03741 | DrugBank |
| HMDB0002176 | HMDB |
| LMFA01020072 | LIPID MAPS |
| Citations |
|---|