EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O2 |
| Net Charge | 0 |
| Average Mass | 102.133 |
| Monoisotopic Mass | 102.06808 |
| SMILES | CC[C@@H](C)C(=O)O |
| InChI | InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/t4-/m1/s1 |
| InChIKey | WLAMNBDJUVNPJU-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-methylbutyric acid (CHEBI:45525) is a 2-methylbutyric acid (CHEBI:37070) |
| (R)-2-methylbutyric acid (CHEBI:45525) is enantiomer of (S)-2-methylbutyric acid (CHEBI:38655) |
| Incoming Relation(s) |
| (S)-2-methylbutyric acid (CHEBI:38655) is enantiomer of (R)-2-methylbutyric acid (CHEBI:45525) |
| IUPAC Name |
|---|
| (2R)-2-methylbutanoic acid |
| Synonyms | Source |
|---|---|
| (2R)-2-methylbutyric acid | ChEBI |
| 2-METHYLBUTANOIC ACID | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| SMB | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1041646 | Gmelin |
| Beilstein:1720484 | Beilstein |
| Citations |
|---|