EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82985 - mevinolinic acid
| Formula | C24H38O6 |
| Net Charge | 0 |
| Average Mass | 422.562 |
| Monoisotopic Mass | 422.26684 |
| SMILES | [H][C@@]12C(=C[C@H](C)C[C@@H]1OC(=O)[C@@H](C)CC)C=C[C@H](C)[C@@H]2CC[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C24H38O6/c1-5-15(3)24(29)30-21-11-14(2)10-17-7-6-16(4)20(23(17)21)9-8-18(25)12-19(26)13-22(27)28/h6-7,10,14-16,18-21,23,25-26H,5,8-9,11-13H2,1-4H3,(H,27,28)/t14-,15-,16-,18+,19+,20-,21-,23-/m0/s1 |
| InChIKey | QLJODMDSTUBWDW-BXMDZJJMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus (ncbitaxon:33178) | - | PubMed (24534845) | Strain: ATCC 20542 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mevinolinic acid (CHEBI:82985) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| mevinolinic acid (CHEBI:82985) has functional parent lovastatin (CHEBI:40303) |
| mevinolinic acid (CHEBI:82985) has role Aspergillus metabolite (CHEBI:76956) |
| mevinolinic acid (CHEBI:82985) has role drug metabolite (CHEBI:49103) |
| mevinolinic acid (CHEBI:82985) has role EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor (CHEBI:35664) |
| mevinolinic acid (CHEBI:82985) has role teratogenic agent (CHEBI:50905) |
| mevinolinic acid (CHEBI:82985) is a carbobicyclic compound (CHEBI:36785) |
| mevinolinic acid (CHEBI:82985) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| mevinolinic acid (CHEBI:82985) is a fatty acid ester (CHEBI:35748) |
| mevinolinic acid (CHEBI:82985) is a polyketide (CHEBI:26188) |
| mevinolinic acid (CHEBI:82985) is conjugate acid of mevinolinate (CHEBI:79038) |
| Incoming Relation(s) |
| mevinolinate (CHEBI:79038) is conjugate base of mevinolinic acid (CHEBI:82985) |
| IUPAC Name |
|---|
| (3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| Synonyms | Source |
|---|---|
| L 154819 | ChemIDplus |
| L-154819 | ChemIDplus |
| Lovastatin acid | ChemIDplus |
| MK 819 | ChemIDplus |
| Monacolinic K acid | ChemIDplus |
| MSD 803 acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4574661 | Reaxys |
| CAS:75225-51-3 | ChemIDplus |
| Citations |
|---|