EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H38O6 |
| Net Charge | 0 |
| Average Mass | 422.562 |
| Monoisotopic Mass | 422.26684 |
| SMILES | [H][C@@]12C(=C[C@H](C)C[C@@H]1OC(=O)[C@@H](C)CC)C=C[C@H](C)[C@@H]2CC[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C24H38O6/c1-5-15(3)24(29)30-21-11-14(2)10-17-7-6-16(4)20(23(17)21)9-8-18(25)12-19(26)13-22(27)28/h6-7,10,14-16,18-21,23,25-26H,5,8-9,11-13H2,1-4H3,(H,27,28)/t14-,15-,16-,18+,19+,20-,21-,23-/m0/s1 |
| InChIKey | QLJODMDSTUBWDW-BXMDZJJMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus (ncbitaxon:33178) | - | PubMed (24534845) | Strain: ATCC 20542 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mevinolinic acid (CHEBI:82985) has functional parent (S)-2-methylbutyric acid (CHEBI:38655) |
| mevinolinic acid (CHEBI:82985) has functional parent lovastatin (CHEBI:40303) |
| mevinolinic acid (CHEBI:82985) has role Aspergillus metabolite (CHEBI:76956) |
| mevinolinic acid (CHEBI:82985) has role drug metabolite (CHEBI:49103) |
| mevinolinic acid (CHEBI:82985) has role EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor (CHEBI:35664) |
| mevinolinic acid (CHEBI:82985) has role teratogenic agent (CHEBI:50905) |
| mevinolinic acid (CHEBI:82985) is a carbobicyclic compound (CHEBI:36785) |
| mevinolinic acid (CHEBI:82985) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| mevinolinic acid (CHEBI:82985) is a fatty acid ester (CHEBI:35748) |
| mevinolinic acid (CHEBI:82985) is a polyketide (CHEBI:26188) |
| mevinolinic acid (CHEBI:82985) is conjugate acid of mevinolinate (CHEBI:79038) |
| Incoming Relation(s) |
| mevinolinate (CHEBI:79038) is conjugate base of mevinolinic acid (CHEBI:82985) |
| IUPAC Name |
|---|
| (3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| Synonyms | Source |
|---|---|
| Hydroxyacid lovastatin | ChEMBL |
| L 154819 | ChemIDplus |
| L-154819 | ChemIDplus |
| lovastatin acid | ChEMBL |
| Lovastatin acid | ChemIDplus |
| Mevinolinic acid | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4574661 | Reaxys |
| CAS:75225-51-3 | ChemIDplus |
| Citations |
|---|