EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O2 |
| Net Charge | -1 |
| Average Mass | 101.125 |
| Monoisotopic Mass | 101.06080 |
| SMILES | CC[C@H](C)C(=O)[O-] |
| InChI | InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/p-1/t4-/m0/s1 |
| InChIKey | WLAMNBDJUVNPJU-BYPYZUCNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-methylbutanoate (CHEBI:145932) is a 2-methyl fatty acid anion (CHEBI:83976) |
| (S)-2-methylbutanoate (CHEBI:145932) is a branched-chain saturated fatty acid anion (CHEBI:58956) |
| (S)-2-methylbutanoate (CHEBI:145932) is a short-chain fatty acid anion (CHEBI:58951) |
| (S)-2-methylbutanoate (CHEBI:145932) is conjugate base of (S)-2-methylbutyric acid (CHEBI:38655) |
| Incoming Relation(s) |
| (S)-2-methylbutyric acid (CHEBI:38655) is conjugate acid of (S)-2-methylbutanoate (CHEBI:145932) |
| IUPAC Name |
|---|
| (2S)-2-methylbutanoate |
| Synonyms | Source |
|---|---|
| (2S)-2-methylbutyric acid anion | ChEBI |
| (S)-2-methylbutyrate | ChEBI |
| (2S)-2-methylbutyrate | ChEBI |
| (S)-α-methylbutyrate | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-2-methylbutanoate | UniProt |
| Citations |
|---|