EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc(O)c(O)c(O)c12 |
| InChI | InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)11-5-9(17)13-12(21-11)6-10(18)14(19)15(13)20/h1-6,16,18-20H |
| InChIKey | JVXZRQGOGOXCEC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scutellarein (CHEBI:9062) has functional parent apigenin (CHEBI:18388) |
| scutellarein (CHEBI:9062) has role metabolite (CHEBI:25212) |
| scutellarein (CHEBI:9062) is a tetrahydroxyflavone (CHEBI:38684) |
| scutellarein (CHEBI:9062) is conjugate acid of scutellarein(1−) (CHEBI:78328) |
| Incoming Relation(s) |
| 4',5,6,7-tetramethoxyflavone (CHEBI:34357) has functional parent scutellarein (CHEBI:9062) |
| 4',6-dihydroxy-5,7-dimethoxyflavone (CHEBI:79619) has functional parent scutellarein (CHEBI:9062) |
| 6-hydroxy-4',5,7-trimethoxyflavone (CHEBI:79509) has functional parent scutellarein (CHEBI:9062) |
| hispidulin (CHEBI:75902) has functional parent scutellarein (CHEBI:9062) |
| ladanein (CHEBI:192702) has functional parent scutellarein (CHEBI:9062) |
| pectolinarigenin (CHEBI:81336) has functional parent scutellarein (CHEBI:9062) |
| plantaginin (CHEBI:80895) has functional parent scutellarein (CHEBI:9062) |
| salvigenin (CHEBI:192703) has functional parent scutellarein (CHEBI:9062) |
| scutellarein 7-methyl ether (CHEBI:192701) has functional parent scutellarein (CHEBI:9062) |
| scutellarin (CHEBI:61278) has functional parent scutellarein (CHEBI:9062) |
| scutellarein(1−) (CHEBI:78328) is conjugate base of scutellarein (CHEBI:9062) |
| IUPAC Name |
|---|
| 5,6,7-trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4',5,6,7-Tetrahydroxyflavanone | ChemIDplus |
| 5,6,7,4'-Tetrahydroxyflavone | ChemIDplus |
| 5,6,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| 6-Hydroxyapigenin | KEGG COMPOUND |
| Isocarthamidin | KEGG COMPOUND |
| Scutellarein | KEGG COMPOUND |
| Citations |
|---|