EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O12 |
| Net Charge | 0 |
| Average Mass | 462.363 |
| Monoisotopic Mass | 462.07983 |
| SMILES | O=C(O)[C@H]1O[C@@H](Oc2cc3oc(-c4ccc(O)cc4)cc(=O)c3c(O)c2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H18O12/c22-8-3-1-7(2-4-8)10-5-9(23)13-11(31-10)6-12(14(24)15(13)25)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-22,24-28H,(H,29,30)/t16-,17-,18+,19-,21+/m0/s1 |
| InChIKey | DJSISFGPUUYILV-ZFORQUDYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scutellarin (CHEBI:61278) has functional parent scutellarein (CHEBI:9062) |
| scutellarin (CHEBI:61278) has role antineoplastic agent (CHEBI:35610) |
| scutellarin (CHEBI:61278) has role proteasome inhibitor (CHEBI:52726) |
| scutellarin (CHEBI:61278) is a glucosiduronic acid (CHEBI:24302) |
| scutellarin (CHEBI:61278) is a glycosyloxyflavone (CHEBI:50018) |
| scutellarin (CHEBI:61278) is a monosaccharide derivative (CHEBI:63367) |
| scutellarin (CHEBI:61278) is a trihydroxyflavone (CHEBI:27116) |
| scutellarin (CHEBI:61278) is conjugate acid of scutellarin(1−) (CHEBI:61284) |
| Incoming Relation(s) |
| scutellarin(1−) (CHEBI:61284) is conjugate base of scutellarin (CHEBI:61278) |
| IUPAC Name |
|---|
| 5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| Scutellarein-7beta-D-glucuronide | ChemIDplus |
| Scutellarein-7beta-D-glucuronoside | ChemIDplus |
| Scutellarein 7-O-β-D-glucuronide | ChEBI |
| Scutellarein-7-glucuronide | ChemIDplus |
| Scutellarein-7-O-beta-D-glucuronide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Scutellarin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:71779 | Reaxys |
| CAS:27740-01-8 | ChemIDplus |
| Citations |
|---|