EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O6 |
| Net Charge | 0 |
| Average Mass | 314.293 |
| Monoisotopic Mass | 314.07904 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)cc1 |
| InChI | InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)13-7-11(18)15-14(23-13)8-12(19)17(22-2)16(15)20/h3-8,19-20H,1-2H3 |
| InChIKey | GPQLHGCIAUEJQK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tanacetum vulgare (ncbitaxon:128002) | - | PubMed (25924515) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pectolinarigenin (CHEBI:81336) has functional parent scutellarein (CHEBI:9062) |
| pectolinarigenin (CHEBI:81336) has role plant metabolite (CHEBI:76924) |
| pectolinarigenin (CHEBI:81336) is a dihydroxyflavone (CHEBI:38686) |
| pectolinarigenin (CHEBI:81336) is a dimethoxyflavone (CHEBI:23798) |
| Incoming Relation(s) |
| pectolinarin (CHEBI:156327) has functional parent pectolinarigenin (CHEBI:81336) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-6-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 4'-Methylcapillarisin | KEGG COMPOUND |
| 5,7-Dihydroxy-4',6-dimethoxyflavone | KEGG COMPOUND |
| scutellarein-6,4'-dimethyl ether | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00003838 | KNApSAcK |
| C17784 | KEGG COMPOUND |
| LMPK12111164 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:315341 | Reaxys |
| CAS:520-12-7 | KEGG COMPOUND |
| CAS:520-12-7 | ChemIDplus |
| Citations |
|---|