EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O6 |
| Net Charge | 0 |
| Average Mass | 342.347 |
| Monoisotopic Mass | 342.11034 |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3o2)cc1 |
| InChI | InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)14-9-13(20)17-15(25-14)10-16(22-2)18(23-3)19(17)24-4/h5-10H,1-4H3 |
| InChIKey | URSUMOWUGDXZHU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus aurantium (ncbitaxon:43166) | - | PubMed (10606602) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4',5,6,7-tetramethoxyflavone (CHEBI:34357) has functional parent scutellarein (CHEBI:9062) |
| 4',5,6,7-tetramethoxyflavone (CHEBI:34357) has role antimutagen (CHEBI:73190) |
| 4',5,6,7-tetramethoxyflavone (CHEBI:34357) has role plant metabolite (CHEBI:76924) |
| 4',5,6,7-tetramethoxyflavone (CHEBI:34357) is a tetramethoxyflavone (CHEBI:76875) |
| IUPAC Name |
|---|
| 5,6,7-trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| Tetra-O-methylscutellarein | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003841 | KNApSAcK |
| C14472 | KEGG COMPOUND |
| HMDB0030575 | HMDB |
| LMPK12111167 | LIPID MAPS |
| Citations |
|---|