EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O11 |
| Net Charge | 0 |
| Average Mass | 448.380 |
| Monoisotopic Mass | 448.10056 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c(O)c12 |
| InChI | InChI=1S/C21H20O11/c22-7-14-17(26)19(28)20(29)21(32-14)31-13-6-12-15(18(27)16(13)25)10(24)5-11(30-12)8-1-3-9(23)4-2-8/h1-6,14,17,19-23,25-29H,7H2/t14-,17-,19+,20-,21-/m1/s1 |
| InChIKey | VUGRLRAUZWGZJP-IAAKTDFRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dracocephalum peregrinum (IPNI:446489-1) | - | PubMed (18958424) | |
| Plantago asiatica (ncbitaxon:197796) | - | PubMed (2488968) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plantaginin (CHEBI:80895) has functional parent scutellarein (CHEBI:9062) |
| plantaginin (CHEBI:80895) has role plant metabolite (CHEBI:76924) |
| plantaginin (CHEBI:80895) is a glycosyloxyflavone (CHEBI:50018) |
| plantaginin (CHEBI:80895) is a monosaccharide derivative (CHEBI:63367) |
| plantaginin (CHEBI:80895) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Scutellarein 7beta-D-glucopyranoside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00004220 | KNApSAcK |
| C17056 | KEGG COMPOUND |
| CN1513862 | Patent |
| LMPK12111109 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1360179 | Reaxys |
| Citations |
|---|