EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O6 |
| Net Charge | 0 |
| Average Mass | 328.320 |
| Monoisotopic Mass | 328.09469 |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(O)c(OC)cc3o2)cc1 |
| InChI | InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)13-8-12(19)16-14(24-13)9-15(22-2)17(20)18(16)23-3/h4-9,20H,1-3H3 |
| InChIKey | XYHIVQHSXGOAQP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy-4',5,7-trimethoxyflavone (CHEBI:79509) has functional parent scutellarein (CHEBI:9062) |
| 6-hydroxy-4',5,7-trimethoxyflavone (CHEBI:79509) has role plant metabolite (CHEBI:76924) |
| 6-hydroxy-4',5,7-trimethoxyflavone (CHEBI:79509) is a monohydroxyflavone (CHEBI:38687) |
| 6-hydroxy-4',5,7-trimethoxyflavone (CHEBI:79509) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 6-hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 6-hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one | ChEBI |
| 5,7,4'-scutellarein trimethylether | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-hydroxy-4',5,7-trimethoxyflavone | UniProt |