EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O6 |
| Net Charge | 0 |
| Average Mass | 314.293 |
| Monoisotopic Mass | 314.07904 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(O)c(OC)cc3o2)cc1 |
| InChI | InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)12-7-11(18)15-13(23-12)8-14(22-2)16(19)17(15)20/h3-8,19-20H,1-2H3 |
| InChIKey | UUQJTIHOVGMQIH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Orthosiphon stamineus (ncbitaxon:260636) | |||
| leaf (BTO:0000713) | PubMed (31678632) | ||
| aerial part (BTO:0001658) | PubMed (11086900) | ||
| Salvia chamelaeagnea (ncbitaxon:1520020) | - | PubMed (31013747) | |
| Coleus amboinicus (ncbitaxon:204180) | leaf (BTO:0000713) | PubMed (26357892) | Species also known as Plectranthus amboinicus. |
| Salvia sharifii (ncbitaxon:1685716) | aerial part (BTO:0001658) | PubMed (24250614) | |
| Marrubium thessalum (ncbitaxon:694371) | aerial part (BTO:0001658) | PubMed (19361824) | |
| Marrubium vulgare (ncbitaxon:41230) | - | DOI (10.1016/j.foodchem.2011.07.112) | |
| Salvia limbata (ncbitaxon:1685713) | aerial part (BTO:0001658) | PubMed (21108116) | |
| Lavandula angustifolia (ncbitaxon:39329) | - | PubMed (17639984) | |
| Salvia rosmarinus (ncbitaxon:39367) | leaf (BTO:0000713) | PubMed (20397728) | Species also known as Rosmarinus officinalis. |
| Artemisia argyi (ncbitaxon:259893) | aerial part (BTO:0001658) | PubMed (12677524) | |
| Thymus piperella (IPNI:461525-1) | aerial part (BTO:0001658) | PubMed (17342612) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ladanein (CHEBI:192702) has functional parent scutellarein (CHEBI:9062) |
| ladanein (CHEBI:192702) has role antiviral agent (CHEBI:22587) |
| ladanein (CHEBI:192702) has role plant metabolite (CHEBI:76924) |
| ladanein (CHEBI:192702) has role radical scavenger (CHEBI:48578) |
| ladanein (CHEBI:192702) is a dihydroxyflavone (CHEBI:38686) |
| ladanein (CHEBI:192702) is a dimethoxyflavone (CHEBI:23798) |
| IUPAC Name |
|---|
| 5,6-dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4',7-dimethylscutellarein | SUBMITTER |
| 5,6-dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one | IUPAC |
| 5,6-dihydroxy-7,4'-dimethoxyflavone | ChEBI |
| BJ486K | ChEBI |
| UniProt Name | Source |
|---|---|
| ladanein | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15632 | MetaCyc |
| LMPK12111165 | LIPID MAPS |
| C00003839 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:10176-71-3 | ChemIDplus |
| Citations |
|---|