EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1c(O)cc2oc(-c3ccc(O)cc3)cc(=O)c2c1O |
| InChI | InChI=1S/C16H12O6/c1-21-16-11(19)7-13-14(15(16)20)10(18)6-12(22-13)8-2-4-9(17)5-3-8/h2-7,17,19-20H,1H3 |
| InChIKey | IHFBPDAQLQOCBX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hispidulin (CHEBI:75902) has functional parent scutellarein (CHEBI:9062) |
| hispidulin (CHEBI:75902) has role anti-inflammatory agent (CHEBI:67079) |
| hispidulin (CHEBI:75902) has role anticonvulsant (CHEBI:35623) |
| hispidulin (CHEBI:75902) has role antineoplastic agent (CHEBI:35610) |
| hispidulin (CHEBI:75902) has role antioxidant (CHEBI:22586) |
| hispidulin (CHEBI:75902) has role apoptosis inducer (CHEBI:68495) |
| hispidulin (CHEBI:75902) has role plant metabolite (CHEBI:76924) |
| hispidulin (CHEBI:75902) is a monomethoxyflavone (CHEBI:25401) |
| hispidulin (CHEBI:75902) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4',5,7-Trihydroxy-6-methoxyflavone | ChemIDplus |
| Dinatin | KEGG COMPOUND |
| Hispidulin | KEGG COMPOUND |
| NSC 122415 | ChemIDplus |
| Scutellarein 6-methyl ether | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001050 | KNApSAcK |
| C10058 | KEGG COMPOUND |
| Hispidulin | Wikipedia |
| LMPK12111159 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1293933 | Reaxys |
| CAS:1447-88-7 | KEGG COMPOUND |
| CAS:1447-88-7 | ChemIDplus |
| Citations |
|---|