EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:192703 - salvigenin
| Formula | C18H16O6 |
| Net Charge | 0 |
| Average Mass | 328.320 |
| Monoisotopic Mass | 328.09469 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)cc1 |
| InChI | InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)13-8-12(19)16-14(24-13)9-15(22-2)18(23-3)17(16)20/h4-9,20H,1-3H3 |
| InChIKey | QCDYOIZVELGOLZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Achillea wilhelmsii (ncbitaxon:282771) | - | PubMed (34209510) | |
| Tanacetum canescens (ncbitaxon:301878) | whole plant (BTO:0001461) | PubMed (24270218) | |
| Ocimum basilicum (ncbitaxon:39350) | - | PubMed (26669105) | |
| Salvia judaica (ncbitaxon:1520030) | aerial part (BTO:0001658) | PubMed (31161797) | |
| Astragalus brachystachys (IPNI:476523-1) | - | PubMed (12562087) | |
| Withania somnifera (ncbitaxon:126910) | - | PubMed (33395575) | |
| Hyssopus cuspidatus (ncbitaxon:1439902) | - | PubMed (34839965) | |
| Teucrium flavum subsp. glaucum (ncbitaxon:1046082) | - | PubMed (33715562) | |
| Ocimum gratissimum (ncbitaxon:204144) | - | PubMed (34901489) | |
| Salvia yangii (ncbitaxon:268885) | leaf (BTO:0000713) | PubMed (26035635) | Species also known as Perovskia atriplicifolia. |
| Salvia atropatana (ncbitaxon:1685711) | aerial part (BTO:0001658) | PubMed (22017660) | |
| Salvia russellii (ncbitaxon:1933755) | aerial part (BTO:0001658) | PubMed (33524860) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salvigenin (CHEBI:192703) has functional parent scutellarein (CHEBI:9062) |
| salvigenin (CHEBI:192703) has role antilipemic drug (CHEBI:35679) |
| salvigenin (CHEBI:192703) has role antineoplastic agent (CHEBI:35610) |
| salvigenin (CHEBI:192703) has role apoptosis inhibitor (CHEBI:68494) |
| salvigenin (CHEBI:192703) has role autophagy inducer (CHEBI:138880) |
| salvigenin (CHEBI:192703) has role hypoglycemic agent (CHEBI:35526) |
| salvigenin (CHEBI:192703) has role immunomodulator (CHEBI:50846) |
| salvigenin (CHEBI:192703) has role neuroprotective agent (CHEBI:63726) |
| salvigenin (CHEBI:192703) has role plant metabolite (CHEBI:76924) |
| salvigenin (CHEBI:192703) is a monohydroxyflavone (CHEBI:38687) |
| salvigenin (CHEBI:192703) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5-hydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5-hydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one | IUPAC |
| 5-hydroxy-6,7,4'-trimethoxy-flavone | ChemIDplus |
| 5-hydroxy-6,7,4'-trimethoxyflavone | ChemIDplus |
| 5-hydroxy-4',6,7-trimethoxyflavone | MetaCyc |
| 7-O-methylpectolinarigenin | MetaCyc |
| psathyrotin | MetaCyc |
| UniProt Name | Source |
|---|---|
| salvigenin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15477 | MetaCyc |
| FDB006184 | FooDB |
| LMPK12111166 | LIPID MAPS |
| C00003840 | KNApSAcK |
| HMDB0128577 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:19103-54-9 | ChemIDplus |
| CAS:19103-54-9 | NIST Chemistry WebBook |
| Citations |
|---|