EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32807 - o-orsellinic acid
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | Cc1cc(O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C8H8O4/c1-4-2-5(9)3-6(10)7(4)8(11)12/h2-3,9-10H,1H3,(H,11,12) |
| InChIKey | AMKYESDOVDKZKV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascomycota sp. Ind19F07 (ncbitaxon:1583058) | - | PubMed (25537370) | |
| Penicillium purpurogenum (ncbitaxon:28575) | mycelium (BTO:0001436) | PubMed (21879714) | Ethylacetate extract of fermentation broth and acetone extract of mycelia Strain: JS03 21 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| o-orsellinic acid (CHEBI:32807) has role fungal metabolite (CHEBI:76946) |
| o-orsellinic acid (CHEBI:32807) has role marine metabolite (CHEBI:76507) |
| o-orsellinic acid (CHEBI:32807) has role metabolite (CHEBI:25212) |
| o-orsellinic acid (CHEBI:32807) is a dihydroxybenzoic acid (CHEBI:23778) |
| o-orsellinic acid (CHEBI:32807) is a resorcinols (CHEBI:33572) |
| o-orsellinic acid (CHEBI:32807) is conjugate acid of o-orsellinate (CHEBI:16162) |
| Incoming Relation(s) |
| o-orsellinate depside (CHEBI:15871) has functional parent o-orsellinic acid (CHEBI:32807) |
| 3-methylorsellinic acid (CHEBI:146309) has functional parent o-orsellinic acid (CHEBI:32807) |
| 3,5-dimethylorsellinic acid (CHEBI:132131) has functional parent o-orsellinic acid (CHEBI:32807) |
| 5-methylorsellinic acid (CHEBI:146307) has functional parent o-orsellinic acid (CHEBI:32807) |
| brartemicin (CHEBI:65512) has functional parent o-orsellinic acid (CHEBI:32807) |
| comazaphilone D (CHEBI:70013) has functional parent o-orsellinic acid (CHEBI:32807) |
| FR191512 (CHEBI:65912) has functional parent o-orsellinic acid (CHEBI:32807) |
| globosumone A (CHEBI:68705) has functional parent o-orsellinic acid (CHEBI:32807) |
| globosumone B (CHEBI:68706) has functional parent o-orsellinic acid (CHEBI:32807) |
| melleolide F (CHEBI:167712) has functional parent o-orsellinic acid (CHEBI:32807) |
| papulacandin (CHEBI:72596) has functional parent o-orsellinic acid (CHEBI:32807) |
| purpurquinone A (CHEBI:69469) has functional parent o-orsellinic acid (CHEBI:32807) |
| purpurquinone C (CHEBI:69471) has functional parent o-orsellinic acid (CHEBI:32807) |
| o-orsellinate (CHEBI:16162) is conjugate base of o-orsellinic acid (CHEBI:32807) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-6-methylbenzoic acid |
| Synonyms | Source |
|---|---|
| 2,4-Dihydroxy-6-methylbenzoic acid | KEGG COMPOUND |
| 4,6-Dihydroxy-o-toluic acid | KEGG COMPOUND |
| o-Orsellinic acid | KEGG COMPOUND |
| orsellic acid | ChemIDplus |
| orsellinic acid | ChEBI |
| Orsellinsäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 6X7 | PDBeChem |
| C00000487 | KNApSAcK |
| C01839 | KEGG COMPOUND |
| CPD-47 | MetaCyc |
| LMPK13010001 | LIPID MAPS |
| LSM-20972 | LINCS |
| Orsellinic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2211027 | Reaxys |
| CAS:480-64-8 | ChemIDplus |
| CAS:480-64-8 | KEGG COMPOUND |
| Citations |
|---|