EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32807 - o-orsellinic acid
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | Cc1cc(O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C8H8O4/c1-4-2-5(9)3-6(10)7(4)8(11)12/h2-3,9-10H,1H3,(H,11,12) |
| InChIKey | AMKYESDOVDKZKV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium purpurogenum (ncbitaxon:28575) | mycelium (BTO:0001436) | PubMed (21879714) | Ethylacetate extract of fermentation broth and acetone extract of mycelia Strain: JS03 21 |
| Ascomycota sp. Ind19F07 (ncbitaxon:1583058) | - | PubMed (25537370) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| o-orsellinic acid (CHEBI:32807) has role fungal metabolite (CHEBI:76946) |
| o-orsellinic acid (CHEBI:32807) has role marine metabolite (CHEBI:76507) |
| o-orsellinic acid (CHEBI:32807) has role metabolite (CHEBI:25212) |
| o-orsellinic acid (CHEBI:32807) is a dihydroxybenzoic acid (CHEBI:23778) |
| o-orsellinic acid (CHEBI:32807) is a resorcinols (CHEBI:33572) |
| o-orsellinic acid (CHEBI:32807) is conjugate acid of o-orsellinate (CHEBI:16162) |
| Incoming Relation(s) |
| o-orsellinate depside (CHEBI:15871) has functional parent o-orsellinic acid (CHEBI:32807) |
| 3-methylorsellinic acid (CHEBI:146309) has functional parent o-orsellinic acid (CHEBI:32807) |
| 3,5-dimethylorsellinic acid (CHEBI:132131) has functional parent o-orsellinic acid (CHEBI:32807) |
| 5-methylorsellinic acid (CHEBI:146307) has functional parent o-orsellinic acid (CHEBI:32807) |
| brartemicin (CHEBI:65512) has functional parent o-orsellinic acid (CHEBI:32807) |
| comazaphilone D (CHEBI:70013) has functional parent o-orsellinic acid (CHEBI:32807) |
| FR191512 (CHEBI:65912) has functional parent o-orsellinic acid (CHEBI:32807) |
| globosumone A (CHEBI:68705) has functional parent o-orsellinic acid (CHEBI:32807) |
| globosumone B (CHEBI:68706) has functional parent o-orsellinic acid (CHEBI:32807) |
| melleolide F (CHEBI:167712) has functional parent o-orsellinic acid (CHEBI:32807) |
| papulacandin (CHEBI:72596) has functional parent o-orsellinic acid (CHEBI:32807) |
| purpurquinone A (CHEBI:69469) has functional parent o-orsellinic acid (CHEBI:32807) |
| purpurquinone C (CHEBI:69471) has functional parent o-orsellinic acid (CHEBI:32807) |
| o-orsellinate (CHEBI:16162) is conjugate base of o-orsellinic acid (CHEBI:32807) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-6-methylbenzoic acid |
| Synonyms | Source |
|---|---|
| o-Orsellinic acid | KEGG COMPOUND |
| 2,4-Dihydroxy-6-methylbenzoic acid | KEGG COMPOUND |
| 4,6-Dihydroxy-o-toluic acid | KEGG COMPOUND |
| orsellic acid | ChemIDplus |
| Orsellinsäure | ChEBI |
| orsellinic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01839 | KEGG COMPOUND |
| LMPK13010001 | LIPID MAPS |
| Orsellinic_acid | Wikipedia |
| CPD-47 | MetaCyc |
| C00000487 | KNApSAcK |
| LSM-20972 | LINCS |
| 6X7 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2211027 | Reaxys |
| CAS:480-64-8 | KEGG COMPOUND |
| CAS:480-64-8 | ChemIDplus |
| Citations |
|---|