EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O5 |
| Net Charge | 0 |
| Average Mass | 250.250 |
| Monoisotopic Mass | 250.08412 |
| SMILES | C/C=C/C(=O)COC(=O)c1c(C)cc(O)cc1O |
| InChI | InChI=1S/C13H14O5/c1-3-4-9(14)7-18-13(17)12-8(2)5-10(15)6-11(12)16/h3-6,15-16H,7H2,1-2H3/b4-3+ |
| InChIKey | KIMBFCFJDPSYCZ-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (15921417) |
| Roles Classification |
|---|
| Biological Role: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| globosumone A (CHEBI:68705) has functional parent o-orsellinic acid (CHEBI:32807) |
| globosumone A (CHEBI:68705) has role Chaetomium metabolite (CHEBI:76960) |
| globosumone A (CHEBI:68705) has role antineoplastic agent (CHEBI:35610) |
| globosumone A (CHEBI:68705) is a benzoate ester (CHEBI:36054) |
| globosumone A (CHEBI:68705) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| (3E)-2-oxopent-3-en-1-yl 2,4-dihydroxy-6-methylbenzoate |
| Synonym | Source |
|---|---|
| 2'-oxo-pent-3'-enyl orsellinate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 9611487 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10265012 | Reaxys |
| Citations |
|---|