EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | Cc1c(O)cc(O)c(C(=O)O)c1C |
| InChI | InChI=1S/C9H10O4/c1-4-5(2)8(9(12)13)7(11)3-6(4)10/h3,10-11H,1-2H3,(H,12,13) |
| InChIKey | GIBRZOCMRFRCOQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Byssochlamys nivea (ncbitaxon:5093) | cell suspension culture (BTO:0000221) | PubMed (15640234) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methylorsellinic acid (CHEBI:146307) has functional parent o-orsellinic acid (CHEBI:32807) |
| 5-methylorsellinic acid (CHEBI:146307) has role fungal metabolite (CHEBI:76946) |
| 5-methylorsellinic acid (CHEBI:146307) is a dihydroxybenzoic acid (CHEBI:23778) |
| 5-methylorsellinic acid (CHEBI:146307) is a resorcinols (CHEBI:33572) |
| 5-methylorsellinic acid (CHEBI:146307) is conjugate acid of 5-methylorsellinate (CHEBI:146172) |
| Incoming Relation(s) |
| 5-methylorsellinate (CHEBI:146172) is conjugate base of 5-methylorsellinic acid (CHEBI:146307) |
| IUPAC Name |
|---|
| 4,6-dihydroxy-2,3-dimethylbenzoic acid |
| Synonyms | Source |
|---|---|
| 2,4-dihydroxy-5,6-dimethylbenzoic acid | ChEBI |
| 5-methylorsellinic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:519-42-6 | ChEBI |
| Citations |
|---|