EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | Cc1c(C)c(C(=O)O)c(O)c(C)c1O |
| InChI | InChI=1S/C10H12O4/c1-4-5(2)8(11)6(3)9(12)7(4)10(13)14/h11-12H,1-3H3,(H,13,14) |
| InChIKey | NZGSNQJCTOMELT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus NIH2624 (ncbitaxon:341663) | - | PubMed (25671343) | Strain: NIH2624 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dimethylorsellinic acid (CHEBI:132131) has functional parent o-orsellinic acid (CHEBI:32807) |
| 3,5-dimethylorsellinic acid (CHEBI:132131) has role Aspergillus metabolite (CHEBI:76956) |
| 3,5-dimethylorsellinic acid (CHEBI:132131) is a dihydroxybenzoic acid (CHEBI:23778) |
| 3,5-dimethylorsellinic acid (CHEBI:132131) is a resorcinols (CHEBI:33572) |
| 3,5-dimethylorsellinic acid (CHEBI:132131) is conjugate acid of 3,5-dimethylorsellinate (CHEBI:131856) |
| Incoming Relation(s) |
| 3,5-dimethylorsellinate (CHEBI:131856) is conjugate base of 3,5-dimethylorsellinic acid (CHEBI:132131) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-3,5,6-trimethylbenzoic acid |
| Synonym | Source |
|---|---|
| DMOA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-17316 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2645681 | Reaxys |
| Citations |
|---|