EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65512 - brartemicin
| Formula | C28H34O17 |
| Net Charge | 0 |
| Average Mass | 642.563 |
| Monoisotopic Mass | 642.17960 |
| SMILES | [H][C@]1(O[C@H]2O[C@H](COC(=O)c3c(C)cc(O)cc3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](COC(=O)c2c(C)cc(O)cc2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H34O17/c1-9-3-11(29)5-13(31)17(9)25(39)41-7-15-19(33)21(35)23(37)27(43-15)45-28-24(38)22(36)20(34)16(44-28)8-42-26(40)18-10(2)4-12(30)6-14(18)32/h3-6,15-16,19-24,27-38H,7-8H2,1-2H3/t15-,16-,19-,20-,21+,22+,23-,24-,27-,28-/m1/s1 |
| InChIKey | UZVUYEBJQAEAGM-SHSJKSAASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nonomuraea (ncbitaxon:83681) | - | PubMed (19358565) |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brartemicin (CHEBI:65512) has functional parent o-orsellinic acid (CHEBI:32807) |
| brartemicin (CHEBI:65512) has functional parent α,α-trehalose (CHEBI:16551) |
| brartemicin (CHEBI:65512) has role antimicrobial agent (CHEBI:33281) |
| brartemicin (CHEBI:65512) has role metabolite (CHEBI:25212) |
| brartemicin (CHEBI:65512) is a benzoate ester (CHEBI:36054) |
| brartemicin (CHEBI:65512) is a glycosyl glycoside derivative (CHEBI:63356) |
| brartemicin (CHEBI:65512) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 6-O-(2,4-dihydroxy-6-methylbenzoyl)-α-D-glucopyranosyl 6-O-(2,4-dihydroxy-6-methylbenzoyl)-α-D-glucopyranoside |
| Manual Xrefs | Databases |
|---|---|
| CN101914118 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19718339 | Reaxys |
| Citations |
|---|