EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65512 - brartemicin
| Formula | C28H34O17 |
| Net Charge | 0 |
| Average Mass | 642.563 |
| Monoisotopic Mass | 642.17960 |
| SMILES | [H][C@]1(O[C@H]2O[C@H](COC(=O)c3c(C)cc(O)cc3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](COC(=O)c2c(C)cc(O)cc2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H34O17/c1-9-3-11(29)5-13(31)17(9)25(39)41-7-15-19(33)21(35)23(37)27(43-15)45-28-24(38)22(36)20(34)16(44-28)8-42-26(40)18-10(2)4-12(30)6-14(18)32/h3-6,15-16,19-24,27-38H,7-8H2,1-2H3/t15-,16-,19-,20-,21+,22+,23-,24-,27-,28-/m1/s1 |
| InChIKey | UZVUYEBJQAEAGM-SHSJKSAASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nonomuraea (ncbitaxon:83681) | - | PubMed (19358565) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brartemicin (CHEBI:65512) has functional parent o-orsellinic acid (CHEBI:32807) |
| brartemicin (CHEBI:65512) has functional parent α,α-trehalose (CHEBI:16551) |
| brartemicin (CHEBI:65512) has role antimicrobial agent (CHEBI:33281) |
| brartemicin (CHEBI:65512) has role metabolite (CHEBI:25212) |
| brartemicin (CHEBI:65512) is a benzoate ester (CHEBI:36054) |
| brartemicin (CHEBI:65512) is a glycosyl glycoside derivative (CHEBI:63356) |
| brartemicin (CHEBI:65512) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 6-O-(2,4-dihydroxy-6-methylbenzoyl)-α-D-glucopyranosyl 6-O-(2,4-dihydroxy-6-methylbenzoyl)-α-D-glucopyranoside |
| Manual Xrefs | Databases |
|---|---|
| CN101914118 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19718339 | Reaxys |
| Citations |
|---|